![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Dallas Police Depart..> | 2011-12-10 06:30 | - | |
| Dymond F Irwin/ | 2011-12-08 13:36 | - | |
| Dymally Representative/ | 2011-12-08 13:36 | - | |
| Dwyer Robert K/ | 2011-12-08 13:36 | - | |
| Dworetsky Michael/ | 2011-12-08 13:36 | - | |
| Duvall J C/ | 2011-12-08 13:36 | - | |
| Dutton Co E P/ | 2011-12-08 13:36 | - | |
| Dutt Yarum Chandra/ | 2011-12-08 13:36 | - | |
| Durr Virginia/ | 2011-12-08 13:36 | - | |
| Durkin Henry P/ | 2011-12-08 13:36 | - | |
| Durham Bill/ | 2011-12-08 13:35 | - | |
| Durenberger David F ..> | 2011-12-08 13:35 | - | |
| Duran Sylvia/ | 2011-12-08 13:35 | - | |
| Dunaway Robert Joseph/ | 2011-12-08 13:35 | - | |
| Dun & Bradstreet Inc/ | 2011-12-08 13:35 | - | |
| Dulles Allen Leaked/ | 2011-12-08 13:35 | - | |
| Dulles Allen FOIA Re..> | 2011-12-08 13:35 | - | |
| Dulles Allen Federal..> | 2011-12-08 13:34 | - | |
| Dulles Allen/ | 2011-12-08 13:34 | - | |
| Dulaney Richard Brooks/ | 2011-12-08 13:34 | - | |
| Duke Steven B/ | 2011-12-08 13:34 | - | |
| Duke David/ | 2011-12-08 13:34 | - | |
| Duff William McEwan/ | 2011-12-08 13:34 | - | |
| Dufala Robert A/ | 2011-12-08 13:34 | - | |
| Ducote Jerome & Sche..> | 2011-12-08 13:34 | - | |
| Dube Louis J Deposit..> | 2011-12-08 13:33 | - | |
| Dube Louis J Deposit..> | 2011-12-08 13:33 | - | |
| du Bois Jules/ | 2011-12-08 13:33 | - | |
| du Berrier Hillaire/ | 2011-12-08 13:33 | - | |
| Drury Lillian Mrs/ | 2011-12-08 13:33 | - | |
| Drummon Roscoe/ | 2011-12-08 13:33 | - | |
| Drug Enforcement Age..> | 2011-12-08 13:33 | - | |
| Drug Enforcement Adm..> | 2011-12-08 13:33 | - | |
| Drug Enforcement Adm..> | 2011-12-08 13:33 | - | |
| Drosnin Michael/ | 2011-12-08 13:33 | - | |
| Drinan Robert F/ | 2011-12-08 13:33 | - | |
| Dreyfus Alfred Captain/ | 2011-12-08 13:32 | - | |
| Drennan Stanley Dr/ | 2011-12-08 13:32 | - | |
| Drenas William M/ | 2011-12-08 13:32 | - | |
| Dreenan Stanley Dr/ | 2011-12-08 13:32 | - | |
| DRE/ | 2011-12-08 13:32 | - | |
| Drake House Publishers/ | 2011-12-08 13:32 | - | |
| Drain Vince SA/ | 2011-12-08 13:32 | - | |
| Drago Charles/ | 2011-12-08 13:32 | - | |
| Doyle Jim 8-mm Film ..> | 2011-12-08 13:32 | - | |
| Doyle Jim/ | 2011-12-08 13:32 | - | |
| Downtown Lincoln-Mer..> | 2011-12-08 13:32 | - | |
| Downs Carville/ | 2011-12-08 13:32 | - | |
| Downing Thomas Repre..> | 2011-12-08 13:32 | - | |
| Downey Morton Jr Show/ | 2011-12-08 13:32 | - | |
| Downey John T/ | 2011-12-08 13:32 | - | |
| Dowe Kenneth/ | 2011-12-08 13:32 | - | |
| Dowde Lewie Raymond/ | 2011-12-08 13:32 | - | |
| Douglas Mike Show The/ | 2011-12-08 13:32 | - | |
| Douglas Daniel Wayne/ | 2011-12-08 13:32 | - | |
| Doughty George Capta..> | 2011-12-08 13:32 | - | |
| Dougherty Jack Edwin/ | 2011-12-08 13:32 | - | |
| Double-Cross Giancanas/ | 2011-12-08 13:32 | - | |
| Double Check/ | 2011-12-08 13:31 | - | |
| Dorman Elsie Mrs Joh..> | 2011-12-08 13:31 | - | |
| Dorland Harold/ | 2011-12-08 13:31 | - | |
| Donovon John K/ | 2011-12-08 13:31 | - | |
| Donner Frank/ | 2011-12-08 13:31 | - | |
| Donnels Joseph Leroy/ | 2011-12-08 13:31 | - | |
| Doniah Susan Jane Ra..> | 2011-12-08 13:31 | - | |
| Donestevez Ramon/ | 2011-12-08 13:31 | - | |
| Donaldson Donald A G..> | 2011-12-08 13:31 | - | |
| Donahue Phil/ | 2011-12-08 13:31 | - | |
| Donahue Jay/ | 2011-12-08 13:31 | - | |
| Donahue Howard/ | 2011-12-08 13:31 | - | |
| Donahue Harold/ | 2011-12-08 13:29 | - | |
| Don Bell Reports/ | 2011-12-08 13:29 | - | |
| Domino Principle/ | 2011-12-08 13:29 | - | |
| Dominican Crisis/ | 2011-12-08 13:29 | - | |
| Domestic Intellignce..> | 2011-12-08 13:29 | - | |
| Domestic Intelligene..> | 2011-12-08 13:29 | - | |
| Domestic Intelligenc..> | 2011-12-08 13:29 | - | |
| Domestic Intelligenc..> | 2011-12-08 13:29 | - | |
| Domestic Intelligenc..> | 2011-12-08 13:29 | - | |
| Domestic Intelligenc..> | 2011-12-08 13:29 | - | |
| Domestic Intelligenc..> | 2011-12-08 13:29 | - | |
| Domestic Intelligenc..> | 2011-12-08 13:29 | - | |
| Domestic Intelligenc..> | 2011-12-08 13:28 | - | |
| Domestic Intelligenc..> | 2011-12-08 13:28 | - | |
| Domestic Intelligenc..> | 2011-12-08 13:28 | - | |
| Domestic Intelligenc..> | 2011-12-08 13:28 | - | |
| Domestic Intelligenc..> | 2011-12-08 13:28 | - | |
| Domestic Intelligenc..> | 2011-12-08 13:28 | - | |
| Domestic Intelligenc..> | 2011-12-08 13:28 | - | |
| Domestic Intelligenc..> | 2011-12-08 13:28 | - | |
| Domestic Intelligenc..> | 2011-12-08 13:27 | - | |
| Domestic Intelligenc..> | 2011-12-08 13:27 | - | |
| Domestic Intelligenc..> | 2011-12-08 13:27 | - | |
| Domestic Intelligenc..> | 2011-12-08 13:27 | - | |
| Domestic Intelligenc..> | 2011-12-08 13:25 | - | |
| Domestic Intelligenc..> | 2011-12-08 13:24 | - | |
| Domestic Intelligenc..> | 2011-12-08 13:24 | - | |
| Domestic Intelligence/ | 2011-12-08 13:24 | - | |
| Dollahite Vernon V/ | 2011-12-08 13:23 | - | |
| Dole Robert Senator/ | 2011-12-08 13:23 | - | |
| Dolce Michele/ | 2011-12-08 13:23 | - | |
| Dolce Joseph Dr/ | 2011-12-08 13:23 | - | |
| Dolan John F/ | 2011-12-08 13:23 | - | |
| Dolan Jackie Mrs L E/ | 2011-12-08 13:23 | - | |
| Dodd Thomas Senator/ | 2011-12-08 13:23 | - | |
| Dobkins William Ray/ | 2011-12-08 13:22 | - | |
| Dmytryk Edward/ | 2011-12-08 13:22 | - | |
| Dixon Jean/ | 2011-12-08 13:22 | - | |
| Dixie Mafia/ | 2011-12-08 13:22 | - | |
| Dixie Bar/ | 2011-12-08 13:22 | - | |
| District of Columbia..> | 2011-12-08 13:22 | - | |
| Distributor News/ | 2011-12-08 13:21 | - | |
| Disarmament Germ War..> | 2011-12-08 13:21 | - | |
| Dirksen Everett Sena..> | 2011-12-08 13:21 | - | |
| Diplomat/ | 2011-12-08 13:21 | - | |
| DiPaolo T/ | 2011-12-08 13:21 | - | |
| Dinkin Eugene PFC/ | 2011-12-08 13:21 | - | |
| Dinacci Al/ | 2011-12-08 13:21 | - | |
| Dimitrov Dimiter Ada..> | 2011-12-08 13:21 | - | |
| Dillard Tom/ | 2011-12-08 13:21 | - | |
| DiEugenio James/ | 2011-12-08 13:21 | - | |
| Dies Subcommittee-Ja..> | 2011-12-08 13:18 | - | |
| Dies Subcommittee Re..> | 2011-12-08 13:18 | - | |
| Dies Subcommittee/ | 2011-12-08 13:17 | - | |
| Dies Martin/ | 2011-12-08 13:17 | - | |
| Dies Committee Stuff..> | 2011-12-08 13:17 | - | |
| Diehl William/ | 2011-12-08 13:16 | - | |
| Didion Joan/ | 2011-12-08 13:16 | - | |
| Dickinson Velvalee Mrs/ | 2011-12-08 13:16 | - | |
| Dickey D Ray/ | 2011-12-08 13:16 | - | |
| Dibben Capes Mariell..> | 2011-12-08 13:16 | - | |
| Diaz-Silveira Ann/ | 2011-12-08 13:16 | - | |
| Diaz Verson Salvador/ | 2011-12-08 13:16 | - | |
| Diaz Gonzalez Eduardo/ | 2011-12-08 13:16 | - | |
| Diario Las Americas/ | 2011-12-08 13:16 | - | |
| DeZutter Henry/ | 2011-12-08 13:16 | - | |
| deVosjoly Philippe L..> | 2011-12-08 13:16 | - | |
| deVosjoli Philippe T..> | 2011-12-08 13:16 | - | |
| DeVinney Fred/ | 2011-12-08 13:16 | - | |
| deValle Eladio/ | 2011-12-08 13:16 | - | |
| Deutsch Karl/ | 2011-12-08 13:16 | - | |
| Deuel Patricia/ | 2011-12-08 13:16 | - | |
| Dettlinger Dan/ | 2011-12-08 13:16 | - | |
| Desperado Films/ | 2011-12-08 13:16 | - | |
| DeSoto Motel/ | 2011-12-08 13:16 | - | |
| Desmaris Gerald/ | 2011-12-08 13:15 | - | |
| DeSlatte Oscar W/ | 2011-12-08 13:15 | - | |
| DeSalles Douglas MD/ | 2011-12-08 13:15 | - | |
| DeSalles Doug Jr/ | 2011-12-08 13:15 | - | |
| Derjebin Petr/ | 2011-12-08 13:15 | - | |
| Derjabin Peter S/ | 2011-12-08 13:15 | - | |
| Depperman William H/ | 2011-12-08 13:15 | - | |
| Department of State ..> | 2011-12-08 13:15 | - | |
| DePino Sam/ | 2011-12-08 13:15 | - | |
| Department of Justic..> | 2011-12-08 13:15 | - | |
| Department of Justic..> | 2011-12-08 13:14 | - | |
| Department of Justic..> | 2011-12-08 13:14 | - | |
| Department of Defens..> | 2011-12-08 13:14 | - | |
| Department of Defens..> | 2011-12-08 13:14 | - | |
| Denson Robert/ | 2011-12-08 13:14 | - | |
| Dempsey William/ | 2011-12-08 13:14 | - | |
| deMohrenschildt Geor..> | 2011-12-08 13:13 | - | |
| deMohrenschildt George/ | 2011-12-08 13:13 | - | |
| Democrats For Nixon-..> | 2011-12-08 13:12 | - | |
| Democratic National ..> | 2011-12-08 13:12 | - | |
| DeMarr William Crowe/ | 2011-12-08 13:10 | - | |
| DeMar Ed 4-2-75/ | 2011-12-08 13:10 | - | |
| DeMar Ed/ | 2011-12-08 13:10 | - | |
| DeLoach Cartha D Ray/ | 2011-12-08 13:10 | - | |
| DeLoach Cartha/ | 2011-12-08 13:10 | - | |
| Dellums Ronald Repre..> | 2011-12-08 13:08 | - | |
| DeLillo Don Libra/ | 2011-12-08 13:08 | - | |
| Delgado Nelson/ | 2011-12-08 13:08 | - | |
| Delaware University of/ | 2011-12-08 13:07 | - | |
| Delaware County Dail..> | 2011-12-08 13:07 | - | |
| Delaune Henry/ | 2011-12-08 13:07 | - | |
| Delaney James Reverend/ | 2011-12-08 13:07 | - | |
| Del Valle Maria/ | 2011-12-08 13:07 | - | |
| Dekker Ken/ | 2011-12-08 13:07 | - | |
| Dekker Alice/ | 2011-12-08 13:07 | - | |
| deGaulle Charles Att..> | 2011-12-08 13:07 | - | |
| deGaulle Charles/ | 2011-12-08 13:07 | - | |
| deGaulle Charkes Ass..> | 2011-12-08 13:07 | - | |
| Degan N Mrs/ | 2011-12-08 13:07 | - | |
| Defense of CIA Phill..> | 2011-12-08 13:07 | - | |
| Defense Investigativ..> | 2011-12-08 13:07 | - | |
| Defense Intelligence..> | 2011-12-08 13:07 | - | |
| Defense Industry Sec..> | 2011-12-08 13:07 | - | |
| Defense Department/ | 2011-12-08 13:07 | - | |
| Defenestration Of He..> | 2011-12-08 13:06 | - | |
| Defender The/ | 2011-12-08 13:06 | - | |
| Defectors/ | 2011-12-08 13:05 | - | |
| Deep Throat W Mark F..> | 2011-12-08 13:05 | - | |
| Deep Throat Jr M/ | 2011-12-08 13:05 | - | |
| Decker J E Sheriff B..> | 2011-12-08 13:04 | - | |
| Decarolis Michael A/ | 2011-12-08 13:04 | - | |
| deBaggio Thomas/ | 2011-12-08 13:04 | - | |
| Deaver Henry Mrs/ | 2011-12-08 13:04 | - | |
| Deaths/ | 2011-12-08 13:04 | - | |
| Death Certificate/ | 2011-12-08 13:04 | - | |
| Dean Patrick T Serge..> | 2011-12-08 13:04 | - | |
| Dean Harry/ | 2011-12-08 13:04 | - | |
| Dealey Plaza Alterat..> | 2011-12-08 13:04 | - | |
| Deak Nicholas/ | 2011-12-08 13:04 | - | |
| Deadly Secrets Hinck..> | 2011-12-08 13:04 | - | |
| de Young Mrs Francis/ | 2011-12-08 13:04 | - | |
| de Toledano Ralph/ | 2011-12-08 13:04 | - | |
| De Shazo John Webster/ | 2011-12-08 13:03 | - | |
| De Lorean John/ | 2011-12-08 13:03 | - | |
| de la Vegas Carlos/ | 2011-12-08 13:03 | - | |
| de Brueys Warren C H..> | 2011-12-08 13:03 | - | |
| de Brueys Warren C/ | 2011-12-08 13:03 | - | |
| de Antonio Emile/ | 2011-12-08 13:03 | - | |
| Day The Dream Died The/ | 2011-12-08 13:03 | - | |
| Day The Dream Died/ | 2011-12-08 13:03 | - | |
| Day J. C. Sergeant/ | 2011-12-08 13:02 | - | |
| Dawson Richard M Cap..> | 2011-12-08 13:02 | - | |
| Dawnay Peter/ | 2011-12-08 13:02 | - | |
| Davy William/ | 2011-12-08 13:02 | - | |
| Davison Jean/ | 2011-12-08 13:02 | - | |
| Davison Alexis H Dr ..> | 2011-12-08 13:02 | - | |
| Davison Alexis dr/ | 2011-12-08 13:02 | - | |
| Davis Virginia Mrs/ | 2011-12-08 13:02 | - | |
| Davis Thomas Eli/ | 2011-12-08 13:01 | - | |
| Davis Rudolph Richard/ | 2011-12-08 13:01 | - | |
| Davis Robert/ | 2011-12-08 13:01 | - | |
| Davis Ricardo/ | 2011-12-08 13:01 | - | |
| Davis Preston/ | 2011-12-08 13:01 | - | |
| Davis Prentiss/ | 2011-12-08 13:01 | - | |
| Davis Nord/ | 2011-12-08 13:01 | - | |
| Davis Morris/ | 2011-12-08 13:01 | - | |
| Davis Ken/ | 2011-12-08 13:00 | - | |
| Davis John Mafia Kin..> | 2011-12-08 13:00 | - | |
| Davis John H Mafia K..> | 2011-12-08 13:00 | - | |
| Davis J Mendel Repre..> | 2011-12-08 13:00 | - | |
| Davis Howard/ | 2011-12-08 13:00 | - | |
| Davis Hardy/ | 2011-12-08 13:00 | - | |
| Davis Eugene C Wanda..> | 2011-12-08 13:00 | - | |
| Davis Donna/ | 2011-12-08 13:00 | - | |
| Davis Charles/ | 2011-12-08 13:00 | - | |
| Davis Angela/ | 2011-12-08 13:00 | - | |
| Davil Detective Memp..> | 2011-12-08 12:59 | - | |
| Davies Colonel/ | 2011-12-08 12:59 | - | |
| Davidson Leon Projec..> | 2011-12-08 12:59 | - | |
| Davidson Leon/ | 2011-12-08 12:59 | - | |
| Davidson Jacob/ | 2011-12-08 12:59 | - | |
| Davidson J P/ | 2011-12-08 12:59 | - | |
| Davidson I Irving/ | 2011-12-08 12:59 | - | |
| Davidov Leonard/ | 2011-12-08 12:58 | - | |
| Davidov Len/ | 2011-12-08 12:58 | - | |
| David Christien Jacq..> | 2011-12-08 12:58 | - | |
| David Christian/ | 2011-12-08 12:58 | - | |
| Daugherty Dudley Tar..> | 2011-12-08 12:58 | - | |
| Dauenhauer, John B/ | 2011-12-08 12:58 | - | |
| Dauenhauer J B/ | 2011-12-08 12:58 | - | |
| Darovich Dennis/ | 2011-12-08 12:58 | - | |
| Darkside of Camelot ..> | 2011-12-08 12:58 | - | |
| Dapondes Andrew/ | 2011-12-08 12:58 | - | |
| Daniels Jack Film JFK/ | 2011-12-08 12:58 | - | |
| Daniel Jean Tiger File/ | 2011-12-08 12:58 | - | |
| Daniel Jean/ | 2011-12-08 12:57 | - | |
| Daniel Jack W/ | 2011-12-08 12:57 | - | |
| Daniel Asa/ | 2011-12-08 12:57 | - | |
| Dane John/ | 2011-12-08 12:57 | - | |
| Danaher J. A/ | 2011-12-08 12:57 | - | |
| Damage Suits/ | 2011-12-08 12:57 | - | |
| Dalzell William Wayne/ | 2011-12-08 12:57 | - | |
| Dallas Trip 6-10-77/ | 2011-12-08 12:57 | - | |
| Dallas Trip 11-22-69/ | 2011-12-08 12:57 | - | |
| Dallas Trip 11-12 77/ | 2011-12-08 12:57 | - | |
| Dallas Times-Herald/ | 2011-12-08 12:57 | - | |
| Dallas Tickler/ | 2011-12-08 12:57 | - | |
| Dallas Right-wing Ac..> | 2011-12-08 12:57 | - | |
| Dallas Researchers 1..> | 2011-12-08 12:57 | - | |
| Dallas Researchers/ | 2011-12-08 12:57 | - | |
| Dallas Records Dalla..> | 2011-12-08 12:55 | - | |
| Dallas Police Broadc..> | 2011-12-08 12:55 | - | |
| Dallas Police/ | 2011-12-08 12:54 | - | |
| Dallas Poice Departm..> | 2011-12-08 12:54 | - | |
| Dallas Municipal Arc..> | 2011-12-08 12:54 | - | |
| Dallas Morning News/ | 2011-12-08 12:54 | - | |
| Dallas Miscellaneous/ | 2011-12-08 12:54 | - | |
| Dallas JFK Memorial/ | 2011-12-08 12:54 | - | |
| Dallas JFK Associati..> | 2011-12-08 12:54 | - | |
| Dallas FBI Field Off..> | 2011-12-08 12:54 | - | |
| Dallas Documents On/ | 2011-12-08 12:54 | - | |
| Dallas Doctors Press..> | 2011-12-08 12:54 | - | |
| Dallas Doctors/ | 2011-12-08 12:53 | - | |
| Dallas County Jail P..> | 2011-12-08 12:53 | - | |
| Dallas Conspiracy/ | 2011-12-08 12:53 | - | |
| Dallas Compliance/ | 2011-12-08 12:53 | - | |
| Dallas Cinema Associ..> | 2011-12-08 12:53 | - | |
| Dallas Cinema Associ..> | 2011-12-08 12:53 | - | |
| Dallas Birchers/ | 2011-12-08 12:53 | - | |
| Dallas Assassination..> | 2011-12-08 12:53 | - | |
| Dallas And Beyond/ | 2011-12-08 12:53 | - | |
| Dallas About/ | 2011-12-08 12:53 | - | |
| Dallas 63/ | 2011-12-08 12:53 | - | |
| Dallas 22 November 1..> | 2011-12-08 12:53 | - | |
| Dale Allan/ | 2011-12-08 12:53 | - | |
| Dal-Tex Building/ | 2011-12-08 12:53 | - | |
| Daily Mirror London/ | 2011-12-08 12:53 | - | |
| D'Avy Leander/ | 2011-12-08 12:53 | - | |
| D Letter/ | 2011-12-08 12:53 | - | |