![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| CA 0226-75 Documents..> | 2011-12-08 10:46 | - | |
| CA 75-0226 8-9-81 We..> | 2011-12-08 10:46 | - | |
| CA 85-292 Gilday Wil..> | 2011-12-08 10:46 | - | |
| Cabal/ | 2011-12-08 10:46 | - | |
| Cabbage Charles Lave..> | 2011-12-08 10:46 | - | |
| Cabell Charles General/ | 2011-12-08 10:46 | - | |
| Cabello Rene/ | 2011-12-08 10:46 | - | |
| Cabluck J/ | 2011-12-08 10:46 | - | |
| Cadden Vivien/ | 2011-12-08 10:47 | - | |
| Cadigan James C/ | 2011-12-08 10:47 | - | |
| Cafaratis Christian/ | 2011-12-08 10:47 | - | |
| Caffney William Frank/ | 2011-12-08 10:47 | - | |
| Caiati Michael/ | 2011-12-08 10:47 | - | |
| Cain Richard Scalley/ | 2011-12-08 10:47 | - | |
| Cain Richard Scully/ | 2011-12-08 10:47 | - | |
| Caire Ronnie/ | 2011-12-08 10:47 | - | |
| Cakebread Walt/ | 2011-12-08 10:47 | - | |
| Caldwell Earl/ | 2011-12-08 10:47 | - | |
| Caldwell Taylor/ | 2011-12-08 10:47 | - | |
| Caley W T/ | 2011-12-08 10:47 | - | |
| Call Richard Dennis ..> | 2011-12-08 10:47 | - | |
| Callahan Bob Who Sho..> | 2011-12-08 10:48 | - | |
| Callaway Howard H Ar..> | 2011-12-08 10:48 | - | |
| Callaway Ted/ | 2011-12-08 10:48 | - | |
| Callendar David/ | 2011-12-08 10:48 | - | |
| Calley William Lt/ | 2011-12-08 10:48 | - | |
| Cameras/ | 2011-12-08 10:48 | - | |
| Camp Street 544/ | 2011-12-08 10:48 | - | |
| Campbell Dan/ | 2011-12-08 10:48 | - | |
| Campbell Elizabeth/ | 2011-12-08 10:48 | - | |
| Campbell Gary/ | 2011-12-08 10:48 | - | |
| Campbell Judith Exner/ | 2011-12-08 10:49 | - | |
| Campbell Louise - Sc..> | 2011-12-08 10:49 | - | |
| Campbell Louise/ | 2011-12-08 10:49 | - | |
| Campisi Joseph/ | 2011-12-08 10:49 | - | |
| Camps Cuban New Orle..> | 2011-12-08 10:49 | - | |
| Campus Unrest Commis..> | 2011-12-08 10:49 | - | |
| Canada - Ray/ | 2011-12-08 10:49 | - | |
| Canada R O Admiral/ | 2011-12-08 10:49 | - | |
| Canadian Broadcastin..> | 2011-12-08 10:49 | - | |
| Cancler John W The B..> | 2011-12-08 10:49 | - | |
| Candid Press/ | 2011-12-08 10:49 | - | |
| Candler Chris/ | 2011-12-08 10:49 | - | |
| Cane Candy/ | 2011-12-08 10:49 | - | |
| Canipe Guy W Jr/ | 2011-12-08 10:49 | - | |
| Canipes Amusement Co..> | 2011-12-08 10:49 | - | |
| Canipes-Jowers Lloyd/ | 2011-12-08 10:50 | - | |
| Cantaneo Jack/ | 2011-12-08 10:50 | - | |
| Capell Frank A/ | 2011-12-08 10:50 | - | |
| Capital Times Madiso..> | 2011-12-08 10:50 | - | |
| Capitol Bombing/ | 2011-12-08 10:50 | - | |
| Capitol Records/ | 2011-12-08 10:51 | - | |
| Caplinger Lane/ | 2011-12-08 10:51 | - | |
| Capote Truman/ | 2011-12-08 10:51 | - | |
| Capp Al/ | 2011-12-08 10:51 | - | |
| Car Presidential/ | 2011-12-08 10:51 | - | |
| Care Barbara/ | 2011-12-08 10:51 | - | |
| Cargill Carol/ | 2011-12-08 10:51 | - | |
| Carle Lee E/ | 2011-12-08 10:51 | - | |
| Carle Lee E Declarat..> | 2011-12-08 10:52 | - | |
| Carlton/ | 2011-12-08 10:52 | - | |
| Carlucci Frank/ | 2011-12-08 10:52 | - | |
| Carmouche Harvey/ | 2011-12-08 10:52 | - | |
| Carnegie Library/ | 2011-12-08 10:52 | - | |
| Carney Raymond/ | 2011-12-08 10:52 | - | |
| Carniglia Elise Mrs/ | 2011-12-08 10:52 | - | |
| Carr Richard A/ | 2011-12-08 10:52 | - | |
| Carr Richard Randolph/ | 2011-12-08 10:52 | - | |
| Carr Wagonner/ | 2011-12-08 10:52 | - | |
| Carrico Charles J Dr/ | 2011-12-08 10:52 | - | |
| Carroll and Graf/ | 2011-12-08 10:54 | - | |
| Carroll and Graf Sel..> | 2011-12-08 10:54 | - | |
| Carroll Audrey Mrs/ | 2011-12-08 10:54 | - | |
| Carroll Bob K/ | 2011-12-08 10:54 | - | |
| Carroll Raymond The ..> | 2011-12-08 10:54 | - | |
| Carroll Warren/ | 2011-12-08 10:54 | - | |
| Carrollton Press Inc/ | 2011-12-08 10:54 | - | |
| Cartels/ | 2011-12-08 10:54 | - | |
| Carter Cliff/ | 2011-12-08 10:54 | - | |
| Carter Joe/ | 2011-12-08 10:54 | - | |
| Carter John/ | 2011-12-08 10:54 | - | |
| Carter John Alvin/ | 2011-12-08 10:54 | - | |
| Cartier Rudolph Lee ..> | 2011-12-08 10:54 | - | |
| Carto Willis/ | 2011-12-08 10:55 | - | |
| Cartor John Alvin/ | 2011-12-08 10:55 | - | |
| Casariego Isaac Dr/ | 2011-12-08 10:55 | - | |
| Casas Jaime/ | 2011-12-08 10:55 | - | |
| Case Clifford P Sena..> | 2011-12-08 10:55 | - | |
| Case of Conspiracy A..> | 2011-12-08 10:55 | - | |
| Case of the Murdered..> | 2011-12-08 10:55 | - | |
| Case Open Reviews & ..> | 2011-12-08 10:55 | - | |
| Casey John C Judge/ | 2011-12-08 10:56 | - | |
| Casey William J/ | 2011-12-08 10:56 | - | |
| Cash Ben/ | 2011-12-08 10:56 | - | |
| Cashner Betty/ | 2011-12-08 10:56 | - | |
| Cason Jack Charles/ | 2011-12-08 10:56 | - | |
| Cassidy John/ | 2011-12-08 10:56 | - | |
| Cassisi Peter/ | 2011-12-08 10:56 | - | |
| Castellano Ernesto/ | 2011-12-08 10:56 | - | |
| Castellano Jorge/ | 2011-12-08 10:56 | - | |
| Castellano Lillian/ | 2011-12-08 10:56 | - | |
| Caster Warren/ | 2011-12-08 10:56 | - | |
| Castillo Carlos/ | 2011-12-08 10:56 | - | |
| Castillo Fernando Ma..> | 2011-12-08 10:56 | - | |
| Castillo Luis Angel/ | 2011-12-08 10:56 | - | |
| Castle Sandra J/ | 2011-12-08 10:56 | - | |
| Castorr L Robert Col..> | 2011-12-08 10:57 | - | |
| Castro Fidel/ | 2011-12-08 10:58 | - | |
| Castro Fidel As JFK ..> | 2011-12-08 10:58 | - | |
| Castro Fidel Plans t..> | 2011-12-08 10:58 | - | |
| Castro Fidel Speeche..> | 2011-12-08 10:58 | - | |
| Castro Fidel Threats..> | 2011-12-08 10:58 | - | |
| Castro Juanita/ | 2011-12-08 10:58 | - | |
| Castro Plots Alleged/ | 2011-12-08 10:59 | - | |
| Castro Plots JFK Kic..> | 2011-12-08 10:59 | - | |
| Cat Man/ | 2011-12-08 10:59 | - | |
| Cataneo Jack/ | 2011-12-08 10:59 | - | |
| Catellano Lillian 2/ | 2011-12-08 10:59 | - | |
| Cater S Douglas/ | 2011-12-08 10:59 | - | |
| Cavalier Rose Miss/ | 2011-12-08 10:59 | - | |
| Cavett Dick/ | 2011-12-08 11:00 | - | |
| CBS/ | 2011-12-08 11:00 | - | |
| CBS 1981/ | 2011-12-08 11:00 | - | |
| CBS Alvarez, Luis/ | 2011-12-08 11:00 | - | |
| CBS FOIA/ | 2011-12-08 11:01 | - | |
| CBS Ray/ | 2011-12-08 11:01 | - | |
| CBS Special Harold W..> | 2011-12-08 11:01 | - | |
| CBS-TV Cuba Project/ | 2011-12-08 11:01 | - | |
| CBS-TV News/ | 2011-12-08 11:01 | - | |
| CBS-TV News Specia, ..> | 2011-12-08 11:01 | - | |
| CBS-TV News Special 01/ | 2011-12-08 11:02 | - | |
| CBS-TV News Special 02/ | 2011-12-08 11:02 | - | |
| CBS-TV News Special ..> | 2011-12-08 11:02 | - | |
| CBS-TV News Special ..> | 2011-12-08 11:02 | - | |
| CBS-TV News Special ..> | 2011-12-08 11:02 | - | |
| CBS-TV News Special ..> | 2011-12-08 11:02 | - | |
| CBS-TV News Special ..> | 2011-12-08 11:03 | - | |
| CBS-TV News Special ..> | 2011-12-08 11:03 | - | |
| CBS-TV News Special ..> | 2011-12-08 11:03 | - | |
| CBS-TV News Special ..> | 2011-12-08 11:03 | - | |
| CBS-TV News Special ..> | 2011-12-08 11:03 | - | |
| CBS-TV News Special ..> | 2011-12-08 11:03 | - | |
| CBS-TV News Special ..> | 2011-12-08 11:03 | - | |
| CBS-TV News Special ..> | 2011-12-08 11:03 | - | |
| CBS-TV News Special ..> | 2011-12-08 11:03 | - | |
| CBS-TV News, Special..> | 2011-12-08 11:04 | - | |
| CBW/ | 2011-12-08 11:04 | - | |
| CD-1347/ | 2011-12-08 11:04 | - | |
| Cellura Frank/ | 2011-12-08 11:05 | - | |
| Center for Constitut..> | 2011-12-08 11:05 | - | |
| Center for National ..> | 2011-12-08 11:05 | - | |
| Center for Study of ..> | 2011-12-08 11:05 | - | |
| Center for the Prese..> | 2011-12-08 11:05 | - | |
| Center for the Study..> | 2011-12-08 11:05 | - | |
| Cerniglia Elise/ | 2011-12-08 11:05 | - | |
| Cerniglia Elise Cuba..> | 2011-12-08 11:06 | - | |
| Chambliss Robert Edw..> | 2011-12-08 11:06 | - | |
| Chaney James M/ | 2011-12-08 11:06 | - | |
| Chang Paul K/ | 2011-12-08 11:06 | - | |
| Chapelaine Perry A/ | 2011-12-08 11:06 | - | |
| Chapman Al/ | 2011-12-08 11:07 | - | |
| Chapman Forest/ | 2011-12-08 11:07 | - | |
| Charach Ted/ | 2011-12-08 11:07 | - | |
| Charles Pedro/ | 2011-12-08 11:07 | - | |
| Charlier Jean-Michael/ | 2011-12-08 11:08 | - | |
| Charns Alexander/ | 2011-12-08 11:08 | - | |
| Chase Peter SA/ | 2011-12-08 11:08 | - | |
| Chastain Wayne/ | 2011-12-08 11:09 | - | |
| Chatelanat Frank/ | 2011-12-08 11:09 | - | |
| Chemical-Biological ..> | 2011-12-08 11:09 | - | |
| Cheramie Rose/ | 2011-12-08 11:09 | - | |
| Cherry Arthur/ | 2011-12-08 11:10 | - | |
| Cheslock William/ | 2011-12-08 11:10 | - | |
| Chetta Nicholas Jr Dr/ | 2011-12-08 11:10 | - | |
| Chicago Daily News/ | 2011-12-08 11:10 | - | |
| Chicago Police Depar..> | 2011-12-08 11:10 | - | |
| Chicago Tribune/ | 2011-12-08 11:10 | - | |
| Childress W F/ | 2011-12-08 11:10 | - | |
| Childs Marquis/ | 2011-12-08 11:10 | - | |
| China/ | 2011-12-08 11:10 | - | |
| China Lobby/ | 2011-12-08 11:10 | - | |
| Chisholm Shirley/ | 2011-12-08 11:10 | - | |
| Chotiner Murray/ | 2011-12-08 11:10 | - | |
| Chriss Nicholas C/ | 2011-12-08 11:10 | - | |
| Christensen Daniel/ | 2011-12-08 11:11 | - | |
| Christian Battle Cry/ | 2011-12-08 11:11 | - | |
| Christian Crusade - ..> | 2011-12-08 11:11 | - | |
| Christian John G/ | 2011-12-08 11:11 | - | |
| Christian John, 1967/ | 2011-12-08 11:12 | - | |
| Christian John, 1968/ | 2011-12-08 11:12 | - | |
| Christian Nationalis..> | 2011-12-08 11:12 | - | |
| Christic Institute/ | 2011-12-08 11:12 | - | |
| Christic Institute A..> | 2011-12-08 11:12 | - | |
| Christopher Warren M/ | 2011-12-08 11:12 | - | |
| Christy Ruth/ | 2011-12-08 11:12 | - | |
| Chronological To Rea..> | 2011-12-08 11:13 | - | |
| Chronologies/ | 2011-12-08 11:13 | - | |
| Chronology Atlanta J..> | 2011-12-08 11:13 | - | |
| Chronology JFK Assas..> | 2011-12-08 11:13 | - | |
| Chronology Log John ..> | 2011-12-08 11:13 | - | |
| Chumir Sheldon/ | 2011-12-08 11:13 | - | |
| Chumir Sheldon Canad..> | 2011-12-08 11:13 | - | |
| Church Committee/ | 2011-12-08 11:13 | - | |
| Church Committee & I..> | 2011-12-08 11:13 | - | |
| Church Committee Dom..> | 2011-12-08 11:14 | - | |
| Church Committee, FOIA/ | 2011-12-08 11:14 | - | |
| Church League of Ame..> | 2011-12-08 11:14 | - | |
| Church of Scientolog..> | 2011-12-08 11:14 | - | |
| Church of the Firstb..> | 2011-12-08 11:14 | - | |
| Churchhill Winston/ | 2011-12-08 11:14 | - | |
| CIA/ | 2011-12-08 11:14 | - | |
| CIA 07-75 to 10-75/ | 2011-12-08 11:15 | - | |
| CIA 10-75 to 03-76/ | 2011-12-08 11:15 | - | |
| CIA Afghanistan/ | 2011-12-08 11:15 | - | |
| CIA Africa/ | 2011-12-08 11:16 | - | |
| CIA Agee Philip/ | 2011-12-08 11:16 | - | |
| CIA Agents General/ | 2011-12-08 11:17 | - | |
| CIA and Harold Weisb..> | 2011-12-08 11:17 | - | |
| CIA Angleton James/ | 2011-12-08 11:17 | - | |
| CIA Aristole Onassis/ | 2011-12-08 11:17 | - | |
| CIA Asia Foundation/ | 2011-12-08 11:18 | - | |
| CIA Assassinations/ | 2011-12-08 11:18 | - | |
| CIA Assassinations C..> | 2011-12-08 11:18 | - | |
| CIA Assassinations C..> | 2011-12-08 11:19 | - | |
| CIA Assassinations D..> | 2011-12-08 11:19 | - | |
| CIA Assassinations H..> | 2011-12-08 11:19 | - | |
| CIA Assault Brigade ..> | 2011-12-08 11:19 | - | |
| CIA Assets and Appro..> | 2011-12-08 11:19 | - | |
| CIA Australia/ | 2011-12-08 11:19 | - | |
| CIA Baker & McKenzie/ | 2011-12-08 11:19 | - | |
| CIA Barnes Tracy/ | 2011-12-08 11:19 | - | |
| CIA BCCI/ | 2011-12-08 11:20 | - | |
| CIA Beers Sharon L W/ | 2011-12-08 11:20 | - | |
| CIA Behavioural Modi..> | 2011-12-08 11:20 | - | |
| CIA Bird Air/ | 2011-12-08 11:20 | - | |
| CIA Bishop Bradford Jr/ | 2011-12-08 11:20 | - | |
| CIA Bissell Richard/ | 2011-12-08 11:20 | - | |
| CIA Blacks/ | 2011-12-08 11:20 | - | |
| CIA Bolivia/ | 2011-12-08 11:21 | - | |
| CIA Books/ | 2011-12-08 11:21 | - | |
| CIA Books About Gene..> | 2011-12-08 11:21 | - | |
| CIA Boyce Christopher/ | 2011-12-08 11:21 | - | |
| CIA Bribery/ | 2011-12-08 11:21 | - | |
| CIA Bush George H W/ | 2011-12-08 11:22 | - | |
| CIA Canada/ | 2011-12-08 11:22 | - | |
| CIA Carson William D/ | 2011-12-08 11:22 | - | |
| CIA Castro Kickback ..> | 2011-12-08 11:22 | - | |
| CIA CBW/ | 2011-12-08 11:22 | - | |
| CIA Chile/ | 2011-12-08 11:25 | - | |
| CIA Chile Letelier K..> | 2011-12-08 11:26 | - | |
| CIA China/ | 2011-12-08 11:26 | - | |
| CIA Clandestine Oper..> | 2011-12-08 11:26 | - | |
| CIA Claridge Duane R..> | 2011-12-08 11:26 | - | |
| CIA Close Raymond H/ | 2011-12-08 11:27 | - | |
| CIA Colby William E/ | 2011-12-08 11:27 | - | |
| CIA Colby William E ..> | 2011-12-08 11:27 | - | |
| CIA Colleges/ | 2011-12-08 11:27 | - | |
| CIA Commission/ | 2011-12-08 11:28 | - | |
| CIA Conein Lucius E/ | 2011-12-08 11:28 | - | |
| CIA Congress/ | 2011-12-08 11:28 | - | |
| CIA Controls On/ | 2011-12-08 11:28 | - | |
| CIA Controls On Carter/ | 2011-12-08 11:30 | - | |
| CIA Controls On Ford/ | 2011-12-08 11:30 | - | |
| CIA Controls On Nixon/ | 2011-12-08 11:30 | - | |
| CIA Controls On Reagan/ | 2011-12-08 11:31 | - | |
| CIA Covers/ | 2011-12-08 11:31 | - | |
| CIA Crimes/ | 2011-12-08 11:31 | - | |
| CIA Critics/ | 2011-12-08 11:31 | - | |
| CIA Cuba Agents/ | 2011-12-08 11:31 | - | |
| CIA Cuba Policy/ | 2011-12-08 11:31 | - | |
| CIA Cuban Exile Zero/ | 2011-12-08 11:31 | - | |
| CIA Cubans/ | 2011-12-08 11:32 | - | |
| CIA Cyprus/ | 2011-12-08 11:32 | - | |
| CIA Dallas Records/ | 2011-12-08 11:32 | - | |
| CIA Davis Jean/ | 2011-12-08 11:32 | - | |
| CIA DC Area Police F..> | 2011-12-08 11:32 | - | |
| CIA Defector Handling/ | 2011-12-08 11:32 | - | |
| CIA DeSilva Peer/ | 2011-12-08 11:32 | - | |
| CIA Dolan J E/ | 2011-12-08 11:32 | - | |
| CIA Dolgun Alexander M/ | 2011-12-08 11:33 | - | |
| CIA Domestic Intelli..> | 2011-12-08 11:33 | - | |
| CIA Domestic Intelli..> | 2011-12-08 11:34 | - | |
| CIA Domestic Intelli..> | 2011-12-08 11:34 | - | |
| CIA Domestic Intelli..> | 2011-12-08 11:35 | - | |
| CIA Domestic Intelli..> | 2011-12-08 11:35 | - | |
| CIA Domestic Intelli..> | 2011-12-08 11:36 | - | |
| CIA Domestic Intelli..> | 2011-12-08 11:37 | - | |
| CIA Domestic Intelli..> | 2011-12-08 11:38 | - | |
| CIA Domestic Mail/ | 2011-12-08 11:38 | - | |
| CIA Domestic Publish..> | 2011-12-08 11:38 | - | |
| CIA Dominican Republic/ | 2011-12-08 11:38 | - | |
| CIA Downey John T/ | 2011-12-08 11:38 | - | |
| CIA DRE Cuban Studen..> | 2011-12-08 11:38 | - | |
| CIA Drugs/ | 2011-12-08 11:38 | - | |
| CIA Duplicates Found..> | 2011-12-08 11:38 | - | |
| CIA Egypt/ | 2011-12-08 11:38 | - | |
| CIA England/ | 2011-12-08 11:38 | - | |
| CIA Ethiopia/ | 2011-12-08 11:38 | - | |
| CIA Europe Secret Ar..> | 2011-12-08 11:39 | - | |
| CIA Eveland Wilbur C..> | 2011-12-08 11:39 | - | |
| CIA Falkiewicz Andre..> | 2011-12-08 11:39 | - | |
| CIA Fassnacht George E/ | 2011-12-08 11:39 | - | |
| CIA FBI Against/ | 2011-12-08 11:39 | - | |
| CIA Ferrara Sal/ | 2011-12-08 11:39 | - | |
| CIA File Numbers/ | 2011-12-08 11:39 | - | |
| CIA Files Destruction/ | 2011-12-08 11:39 | - | |
| CIA FOIA Not Filed E..> | 2011-12-08 11:39 | - | |
| CIA Foreign Broadcas..> | 2011-12-08 11:39 | - | |
| CIA Foreign Operations/ | 2011-12-08 11:39 | - | |
| CIA Forty Committee/ | 2011-12-08 11:39 | - | |
| CIA Forum World Feat..> | 2011-12-08 11:39 | - | |
| CIA Foundations/ | 2011-12-08 11:41 | - | |
| CIA Foundations Afri..> | 2011-12-08 11:41 | - | |
| CIA Foundations Fronts/ | 2011-12-08 11:41 | - | |
| CIA Foundations Gree..> | 2011-12-08 11:42 | - | |
| CIA Gates Robert M/ | 2011-12-08 11:42 | - | |
| CIA Gaudet William G..> | 2011-12-08 11:42 | - | |
| CIA General/ | 2011-12-08 11:44 | - | |
| CIA General Aircarft..> | 2011-12-08 11:44 | - | |
| CIA General Miscella..> | 2011-12-08 11:46 | - | |
| CIA Gentile G Marvin/ | 2011-12-08 11:46 | - | |
| CIA George Clair/ | 2011-12-08 11:46 | - | |
| CIA Germany/ | 2011-12-08 11:46 | - | |
| CIA Giancana Sam/ | 2011-12-08 11:46 | - | |
| CIA Gouggleman Tucker/ | 2011-12-08 11:46 | - | |
| CIA Graham Daniel Ma..> | 2011-12-08 11:46 | - | |
| CIA Greece/ | 2011-12-08 11:47 | - | |
| CIA Guatamala/ | 2011-12-08 11:47 | - | |
| CIA Guinea/ | 2011-12-08 11:47 | - | |
| CIA Guyana/ | 2011-12-08 11:47 | - | |
| CIA Hartley William R/ | 2011-12-08 11:47 | - | |
| CIA Harvey William K..> | 2011-12-08 11:47 | - | |
| CIA Heine v Juri Raus/ | 2011-12-08 11:47 | - | |
| CIA Helms Richard 1-..> | 2011-12-08 11:48 | - | |
| CIA Herring George/ | 2011-12-08 11:48 | - | |
| CIA House Committee ..> | 2011-12-08 11:48 | - | |
| CIA Hugel Max/ | 2011-12-08 11:48 | - | |
| CIA Hughes Howard Pl..> | 2011-12-08 11:48 | - | |
| CIA Hunt James Ramsay/ | 2011-12-08 11:48 | - | |
| CIA Hunter Report/ | 2011-12-08 11:48 | - | |
| CIA India/ | 2011-12-08 11:48 | - | |
| CIA Indonesia/ | 2011-12-08 11:49 | - | |
| CIA International Po..> | 2011-12-08 11:49 | - | |
| CIA Iran Iran-Contra/ | 2011-12-08 11:50 | - | |
| CIA Iraq Iran-Contra/ | 2011-12-08 11:51 | - | |
| CIA Israel/ | 2011-12-08 11:51 | - | |
| CIA Italy/ | 2011-12-08 11:51 | - | |
| CIA Jackson Morton/ | 2011-12-08 11:51 | - | |
| CIA Jamaica/ | 2011-12-08 11:51 | - | |
| CIA James Peter M/ | 2011-12-08 11:51 | - | |
| CIA Japan/ | 2011-12-08 11:51 | - | |
| CIA Jim/ | 2011-12-08 11:51 | - | |
| CIA Johnstone Isabel/ | 2011-12-08 11:51 | - | |
| CIA Jordan Donald S/ | 2011-12-08 11:51 | - | |
| CIA Kampiles William P/ | 2011-12-08 11:51 | - | |
| CIA Karamessines Tho..> | 2011-12-08 11:51 | - | |
| CIA Kennedy Robert F/ | 2011-12-08 11:52 | - | |
| CIA Kimsey Herman/ | 2011-12-08 11:52 | - | |
| CIA Kindschi Jack/ | 2011-12-08 11:52 | - | |
| CIA King Martin Luth..> | 2011-12-08 11:52 | - | |
| CIA Kirkpatrick Lymo..> | 2011-12-08 11:52 | - | |
| CIA Labor/ | 2011-12-08 11:52 | - | |
| CIA Lake Anthony/ | 2011-12-08 11:52 | - | |
| CIA Langer William Dr/ | 2011-12-08 11:52 | - | |
| CIA Lawrence Vint/ | 2011-12-08 11:52 | - | |
| CIA Lies/ | 2011-12-08 11:52 | - | |
| CIA Lippert Ronald P..> | 2011-12-08 11:52 | - | |
| CIA Littauer Foundat..> | 2011-12-08 11:52 | - | |
| CIA Long Cheng/ | 2011-12-08 11:52 | - | |
| CIA Marchetti Victor/ | 2011-12-08 11:53 | - | |
| CIA Marrs Theodore C/ | 2011-12-08 11:53 | - | |
| CIA McCone John A/ | 2011-12-08 11:53 | - | |
| CIA McGarvey Patrick/ | 2011-12-08 11:53 | - | |
| CIA Mexico/ | 2011-12-08 11:53 | - | |
| CIA Meyer Cord/ | 2011-12-08 11:53 | - | |
| CIA Middle East/ | 2011-12-08 11:53 | - | |
| CIA Miscellaneous/ | 2011-12-08 11:53 | - | |
| CIA MLK-JER Sanitize..> | 2011-12-08 11:53 | - | |
| CIA Moore Edwin G/ | 2011-12-08 11:54 | - | |
| CIA Mullen Jay/ | 2011-12-08 11:54 | - | |
| CIA Nagy-Talavera Ni..> | 2011-12-08 11:54 | - | |
| CIA National Name In..> | 2011-12-08 11:54 | - | |
| CIA National Photogr..> | 2011-12-08 11:54 | - | |
| CIA National Securit..> | 2011-12-08 11:54 | - | |
| CIA Nelson William/ | 2011-12-08 11:54 | - | |
| CIA New Orleans/ | 2011-12-08 11:54 | - | |
| CIA New York Publish..> | 2011-12-08 11:54 | - | |
| CIA New York Times S..> | 2011-12-08 11:54 | - | |
| CIA Nightwatch The/ | 2011-12-08 11:54 | - | |
| CIA Noriega Manuel A..> | 2011-12-08 11:54 | - | |
| CIA Nosenko Yuri FOI..> | 2011-12-08 11:54 | - | |
| CIA Ober Richard/ | 2011-12-08 11:54 | - | |
| CIA Office of Strate..> | 2011-12-08 11:54 | - | |
| CIA Olson Frank/ | 2011-12-08 11:55 | - | |
| CIA Onassis Aristotle/ | 2011-12-08 11:55 | - | |
| CIA Operation Chaos/ | 2011-12-08 11:55 | - | |
| CIA Organizational C..> | 2011-12-08 11:55 | - | |
| CIA Oswald Lee Harve..> | 2011-12-08 11:55 | - | |
| CIA Oswald Lee Harve..> | 2011-12-08 11:55 | - | |
| CIA Oversight House ..> | 2011-12-08 11:55 | - | |
| CIA Oversight Senate/ | 2011-12-08 11:55 | - | |
| CIA Paisley John A/ | 2011-12-08 11:56 | - | |
| CIA Phillips David A..> | 2011-12-08 11:56 | - | |
| CIA Polgar Tom/ | 2011-12-08 11:56 | - | |
| CIA Police/ | 2011-12-08 11:56 | - | |
| CIA Political Colora..> | 2011-12-08 11:56 | - | |
| CIA Press Bernstein ..> | 2011-12-08 11:56 | - | |
| CIA Press Self-Promo..> | 2011-12-08 11:57 | - | |
| CIA Professors/ | 2011-12-08 11:57 | - | |
| CIA Project Merrimack/ | 2011-12-08 11:57 | - | |
| CIA Project Resistance/ | 2011-12-08 11:57 | - | |
| CIA Psychological As..> | 2011-12-08 11:57 | - | |
| CIA Ray Manuel/ | 2011-12-08 11:57 | - | |
| CIA Re-file/ | 2011-12-08 11:57 | - | |
| CIA Records Referral..> | 2011-12-08 11:58 | - | |
| CIA Recruiting/ | 2011-12-08 11:58 | - | |
| CIA Releases 1976/ | 2011-12-08 11:59 | - | |
| CIA Releases 1976-77/ | 2011-12-08 11:59 | - | |
| CIA Releases 1977 Ba..> | 2011-12-08 11:59 | - | |
| CIA Reporters/ | 2011-12-08 12:00 | - | |
| CIA Reporters New Yo..> | 2011-12-08 12:00 | - | |
| CIA Rewald Ronald R/ | 2011-12-08 12:00 | - | |
| CIA Rhodesia/ | 2011-12-08 12:00 | - | |
| CIA Rocca Raymond/ | 2011-12-08 12:00 | - | |
| CIA Rogouin Mitchell/ | 2011-12-08 12:00 | - | |
| CIA Roijen Robert Van/ | 2011-12-08 12:00 | - | |
| CIA Roosevelt Kim/ | 2011-12-08 12:00 | - | |
| CIA Rositzke Harry/ | 2011-12-08 12:00 | - | |
| CIA Rossiter Publica..> | 2011-12-08 12:00 | - | |
| CIA Ruiz Maria del C..> | 2011-12-08 12:00 | - | |
| CIA Scelso John aka/ | 2011-12-08 12:00 | - | |
| CIA Schneider Martha/ | 2011-12-08 12:00 | - | |
| CIA Secrecy/ | 2011-12-08 12:00 | - | |
| CIA Sex/ | 2011-12-08 12:00 | - | |
| CIA Shlaudeman Harry/ | 2011-12-08 12:00 | - | |
| CIA Smith Josph B Po..> | 2011-12-08 12:01 | - | |
| CIA Snepp Frank/ | 2011-12-08 12:01 | - | |
| CIA Sorenson Theodor..> | 2011-12-08 12:01 | - | |
| CIA Sources and Meth..> | 2011-12-08 12:01 | - | |
| CIA South Africa/ | 2011-12-08 12:01 | - | |
| CIA Southeast Asia/ | 2011-12-08 12:02 | - | |
| CIA Southern Air Tra..> | 2011-12-08 12:02 | - | |
| CIA Soviet Use of As..> | 2011-12-08 12:02 | - | |
| CIA Spain/ | 2011-12-08 12:02 | - | |
| CIA Special Activiti..> | 2011-12-08 12:02 | - | |
| CIA Stapleton/ | 2011-12-08 12:02 | - | |
| CIA Station Chief of..> | 2011-12-08 12:02 | - | |
| CIA Stockwell John/ | 2011-12-08 12:02 | - | |
| CIA Students for a D..> | 2011-12-08 12:02 | - | |
| CIA Sullivan David S/ | 2011-12-08 12:02 | - | |
| CIA Sweden/ | 2011-12-08 12:02 | - | |
| CIA Tchkotoua Dmitri..> | 2011-12-08 12:02 | - | |
| CIA Terpil Frank/ | 2011-12-08 12:02 | - | |
| CIA Thompson James H W/ | 2011-12-08 12:02 | - | |
| CIA Tibet/ | 2011-12-08 12:03 | - | |
| CIA Training Equipme..> | 2011-12-08 12:03 | - | |
| CIA Turkey/ | 2011-12-08 12:03 | - | |
| CIA Turner Stansfiel..> | 2011-12-08 12:03 | - | |
| CIA United Auto Work..> | 2011-12-08 12:03 | - | |
| CIA Walters Vernon L..> | 2011-12-08 12:03 | - | |
| CIA Warren Commissio..> | 2011-12-08 12:03 | - | |
| CIA Watergate/ | 2011-12-08 12:03 | - | |
| CIA Weisberg Harold/ | 2011-12-08 12:03 | - | |
| CIA Wells William/ | 2011-12-08 12:03 | - | |
| CIA Wilcott James Te..> | 2011-12-08 12:03 | - | |
| CIA Wilson Edwin P/ | 2011-12-08 12:04 | - | |
| CIA Withholding/ | 2011-12-08 12:04 | - | |
| CIA Wood Robert/ | 2011-12-08 12:04 | - | |
| CIA World Vision/ | 2011-12-08 12:04 | - | |
| CIA Ziebell Launie M/ | 2011-12-08 12:04 | - | |
| CIA ZR-Rifle/ | 2011-12-08 12:04 | - | |
| Ciaiti Michael/ | 2011-12-08 12:04 | - | |
| Cincinnati Enquirer ..> | 2011-12-08 12:04 | - | |
| Cincinnati Post & Ti..> | 2011-12-08 12:04 | - | |
| Ciravalo John/ | 2011-12-08 12:04 | - | |
| Cisneros Rogelio/ | 2011-12-08 12:04 | - | |
| Citizen's Band Broad..> | 2011-12-08 12:04 | - | |
| Citizen's Committee ..> | 2011-12-08 12:05 | - | |
| Citizen's Committee ..> | 2011-12-08 12:05 | - | |
| Citizens Alert/ | 2011-12-08 12:05 | - | |
| Citizens Campaign Co..> | 2011-12-08 12:05 | - | |
| Citizens Committee F..> | 2011-12-08 12:05 | - | |
| Citizens For Truth A..> | 2011-12-08 12:05 | - | |
| Citizens For Truth I..> | 2011-12-08 12:05 | - | |
| Civello Joseph Francis/ | 2011-12-08 12:05 | - | |
| Civic Groups/ | 2011-12-08 12:05 | - | |
| Civil Air Patrol/ | 2011-12-08 12:05 | - | |
| Civil Rights Divisio..> | 2011-12-08 12:05 | - | |
| Civil Rights Law/ | 2011-12-08 12:05 | - | |
| Civiletti Benjamin R/ | 2011-12-08 12:05 | - | |
| Clancy Donald D/ | 2011-12-08 12:05 | - | |
| Clark Al/ | 2011-12-08 12:05 | - | |
| Clark Comer/ | 2011-12-08 12:05 | - | |
| Clark Joseph Senator/ | 2011-12-08 12:05 | - | |
| Clark Ramsey/ | 2011-12-08 12:06 | - | |
| Clark Ramsey Draft S..> | 2011-12-08 12:06 | - | |
| Clark Ramsey Executi..> | 2011-12-08 12:06 | - | |
| Clark Ramsey Stateme..> | 2011-12-08 12:07 | - | |
| Clark Ramsey Stateme..> | 2011-12-08 12:07 | - | |
| Clark Ramsey Stateme..> | 2011-12-08 12:07 | - | |
| Clark William Kemp/ | 2011-12-08 12:07 | - | |
| Classification/ | 2011-12-08 12:07 | - | |
| Classification Commi..> | 2011-12-08 12:07 | - | |
| Classification Unjus..> | 2011-12-08 12:07 | - | |
| Clay Tom/ | 2011-12-08 12:07 | - | |
| Cleaver Eldridge/ | 2011-12-08 12:07 | - | |
| Clements Manning Int..> | 2011-12-08 12:07 | - | |
| Click/ | 2011-12-08 12:08 | - | |
| Click Darryl/ | 2011-12-08 12:08 | - | |
| Click Records 9-16-88/ | 2011-12-08 12:08 | - | |
| Clifford John/ | 2011-12-08 12:09 | - | |
| Clift Charles/ | 2011-12-08 12:09 | - | |
| Clifton Chester V Jr..> | 2011-12-08 12:09 | - | |
| Cline Ray S/ | 2011-12-08 12:09 | - | |
| Clinton LA Witnesses/ | 2011-12-08 12:09 | - | |
| Clinton Louisiana Wi..> | 2011-12-08 12:09 | - | |
| Clinton William Jeff..> | 2011-12-08 12:09 | - | |
| Clinton William Jeff..> | 2011-12-08 12:09 | - | |
| Clinton, William Jef..> | 2011-12-08 12:09 | - | |
| Clipboard/ | 2011-12-08 12:09 | - | |
| Close Raymond H/ | 2011-12-08 12:09 | - | |
| Clothing Kennedy Joh..> | 2011-12-08 12:10 | - | |
| Clothing Victims/ | 2011-12-08 12:10 | - | |
| Cloud John/ | 2011-12-08 12:10 | - | |
| Clubb Edmund/ | 2011-12-08 12:10 | - | |
| Coalition on Politic..> | 2011-12-08 12:10 | - | |
| Cobb Lloyd/ | 2011-12-08 12:10 | - | |
| Cochise/ | 2011-12-08 12:10 | - | |
| Cochran Johnnie/ | 2011-12-08 12:10 | - | |
| Cockburn Alexander/ | 2011-12-08 12:10 | - | |
| Cockburn Leslie Mrs/ | 2011-12-08 12:10 | - | |
| Cockrel Claude/ | 2011-12-08 12:11 | - | |
| Cody Bill/ | 2011-12-08 12:11 | - | |
| Coffin Tristan/ | 2011-12-08 12:11 | - | |
| Coffney William Frank/ | 2011-12-08 12:11 | - | |
| Cohen Jacob/ | 2011-12-08 12:11 | - | |
| Cohen Jeff/ | 2011-12-08 12:11 | - | |
| Cohen Michael/ | 2011-12-08 12:12 | - | |
| Cohen Sidney Dr/ | 2011-12-08 12:12 | - | |
| Cohn Roy/ | 2011-12-08 12:12 | - | |
| Cohoon Laura/ | 2011-12-08 12:12 | - | |
| Colby William E. Rep..> | 2011-12-08 12:12 | - | |
| Cold War Craziness/ | 2011-12-08 12:12 | - | |
| Cole Chelise Ann/ | 2011-12-08 12:12 | - | |
| Cole Robert Clayton/ | 2011-12-08 12:12 | - | |
| Coleman Loren/ | 2011-12-08 12:12 | - | |
| Coleman William Thad..> | 2011-12-08 12:12 | - | |
| Collacchi Paul/ | 2011-12-08 12:12 | - | |
| Collado Carlos Rivero/ | 2011-12-08 12:12 | - | |
| Collectors Archive/ | 2011-12-08 12:12 | - | |
| Colls Salavtore Rene..> | 2011-12-08 12:12 | - | |
| Colmer William M Con..> | 2011-12-08 12:13 | - | |
| Colon Humberto Carri..> | 2011-12-08 12:13 | - | |
| Columbia College/ | 2011-12-08 12:13 | - | |
| Columbia School of J..> | 2011-12-08 12:13 | - | |
| Columbus Christopher/ | 2011-12-08 12:13 | - | |
| Comart Roy/ | 2011-12-08 12:13 | - | |
| Coming Apart/ | 2011-12-08 12:13 | - | |
| Commemoration of Kin..> | 2011-12-08 12:13 | - | |
| Commentary/ | 2011-12-08 12:13 | - | |
| Commercial Appeal/ | 2011-12-08 12:13 | - | |
| Commercialization an..> | 2011-12-08 12:13 | - | |
| Commission on Domest..> | 2011-12-08 12:13 | - | |
| Commission Work/ | 2011-12-08 12:13 | - | |
| Commissions General/ | 2011-12-08 12:13 | - | |
| Committee For Action..> | 2011-12-08 12:14 | - | |
| Committee For Free C..> | 2011-12-08 12:14 | - | |
| Committee For Open A..> | 2011-12-08 12:14 | - | |
| Committee The/ | 2011-12-08 12:15 | - | |
| Committee to Finger ..> | 2011-12-08 12:15 | - | |
| Committee to Investi..> | 2011-12-08 12:15 | - | |
| Committee to Investi..> | 2011-12-08 12:15 | - | |
| Committee to Investi..> | 2011-12-08 12:15 | - | |
| Committee to Restore..> | 2011-12-08 12:16 | - | |
| Common Sense/ | 2011-12-08 12:16 | - | |
| Communist Anti Hyste..> | 2011-12-08 12:16 | - | |
| Communist Involvemen..> | 2011-12-08 12:16 | - | |
| Compton Tom/ | 2011-12-08 12:16 | - | |
| Computer Electronic ..> | 2011-12-08 12:16 | - | |
| Computers About Them/ | 2011-12-08 12:16 | - | |
| Comstock Raymond Lie..> | 2011-12-08 12:16 | - | |
| Concentration Camps/ | 2011-12-08 12:16 | - | |
| Conein Lucius E/ | 2011-12-08 12:16 | - | |
| Confederate Army/ | 2011-12-08 12:16 | - | |
| Confession 1978/ | 2011-12-08 12:16 | - | |
| Confidential Flash/ | 2011-12-08 12:16 | - | |
| Conforto Janet Jeann..> | 2011-12-08 12:16 | - | |
| Conklin Michael J/ | 2011-12-08 12:17 | - | |
| Connally Fragments A..> | 2011-12-08 12:17 | - | |
| Connally John B Jr/ | 2011-12-08 12:17 | - | |
| Connally John B Jr C..> | 2011-12-08 12:17 | - | |
| Connally John B Jr I..> | 2011-12-08 12:18 | - | |
| Connally John B Jr X..> | 2011-12-08 12:18 | - | |
| Connallys John B Jr ..> | 2011-12-08 12:19 | - | |
| Connell Lucile/ | 2011-12-08 12:19 | - | |
| Connick Harry F/ | 2011-12-08 12:19 | - | |
| Conojo Ralph/ | 2011-12-08 12:19 | - | |
| Conroy Edward A/ | 2011-12-08 12:19 | - | |
| Considine Bob/ | 2011-12-08 12:19 | - | |
| Conspiracies Other A..> | 2011-12-08 12:19 | - | |
| Conspiracies Unlimited/ | 2011-12-08 12:19 | - | |
| Conspiracy/ | 2011-12-08 12:19 | - | |
| Conspiracy Age of US..> | 2011-12-08 12:19 | - | |
| Conspiracy Alleged B..> | 2011-12-08 12:19 | - | |
| Conspiracy Digest/ | 2011-12-08 12:19 | - | |
| Conspiracy Indicatio..> | 2011-12-08 12:19 | - | |
| Conspiracy Museum Th..> | 2011-12-08 12:20 | - | |
| Conspiracy Networks/ | 2011-12-08 12:20 | - | |
| Conspiracy Ray/ | 2011-12-08 12:23 | - | |
| Conspiracy Warren Co..> | 2011-12-08 12:23 | - | |
| Consultancy JFK/ | 2011-12-08 12:24 | - | |
| Consultants/ | 2011-12-08 12:24 | - | |
| Contemporary Authors/ | 2011-12-08 12:24 | - | |
| Contratto Dana/ | 2011-12-08 12:24 | - | |
| Control Economic and..> | 2011-12-08 12:24 | - | |
| Conversations With K..> | 2011-12-08 12:24 | - | |
| Conyers John Represe..> | 2011-12-08 12:24 | - | |
| Cook Fred/ | 2011-12-08 12:25 | - | |
| Cooper D B/ | 2011-12-08 12:25 | - | |
| Cooper John Sherman/ | 2011-12-08 12:26 | - | |
| Cooper John Sherman ..> | 2011-12-08 12:26 | - | |
| Cooper John Sherman ..> | 2011-12-08 12:26 | - | |
| Cooper John Sherman ..> | 2011-12-08 12:27 | - | |
| Cooper John Sherman ..> | 2011-12-08 12:28 | - | |
| Cooper William H/ | 2011-12-08 12:28 | - | |
| Coopersmith Dina/ | 2011-12-08 12:28 | - | |
| Coordination of Unit..> | 2011-12-08 12:29 | - | |
| Copeland Miles/ | 2011-12-08 12:29 | - | |
| Copley News Service/ | 2011-12-08 12:29 | - | |
| Copley Press Inc/ | 2011-12-08 12:29 | - | |
| Coporan John/ | 2011-12-08 12:29 | - | |
| Core Jesse/ | 2011-12-08 12:29 | - | |
| Corley William/ | 2011-12-08 12:29 | - | |
| Cornwell Gary/ | 2011-12-08 12:29 | - | |
| Corporan John WDSU-TV/ | 2011-12-08 12:29 | - | |
| Corson William/ | 2011-12-08 12:29 | - | |
| Cost Time Data/ | 2011-12-08 12:30 | - | |
| Costello George/ | 2011-12-08 12:31 | - | |
| Cottler Joseph/ | 2011-12-08 12:31 | - | |
| Cottman Ivan/ | 2011-12-08 12:31 | - | |
| Cotton Dorothy/ | 2011-12-08 12:31 | - | |
| Couch Blake/ | 2011-12-08 12:31 | - | |
| Couch Malcom/ | 2011-12-08 12:31 | - | |
| Coulter John Stone/ | 2011-12-08 12:31 | - | |
| Council for Practica..> | 2011-12-08 12:31 | - | |
| Councilor The/ | 2011-12-08 12:32 | - | |
| Countdown in Dallas/ | 2011-12-08 12:32 | - | |
| Counter-revolutionar..> | 2011-12-08 12:32 | - | |
| Counterplot/ | 2011-12-08 12:32 | - | |
| Coup dEtat Knopf/ | 2011-12-08 12:32 | - | |
| Coups dEtat General/ | 2011-12-08 12:32 | - | |
| Courtney Alan/ | 2011-12-08 12:33 | - | |
| Court of Two Sisters/ | 2011-12-08 12:33 | - | |
| Courtney Kent/ | 2011-12-08 12:33 | - | |
| Courtright Bill/ | 2011-12-08 12:33 | - | |
| Cover The Bureau Paper/ | 2011-12-08 12:33 | - | |
| Cover-Up Shaw Gary a..> | 2011-12-08 12:33 | - | |
| Covert Action Inform..> | 2011-12-08 12:33 | - | |
| Cox Archibald Re H H..> | 2011-12-08 12:33 | - | |
| Cox Charles/ | 2011-12-08 12:33 | - | |
| Cox Papers/ | 2011-12-08 12:33 | - | |
| Coxe Robert W/ | 2011-12-08 12:33 | - | |
| Crafrad Curtis Laver..> | 2011-12-08 12:33 | - | |
| Craig Roger/ | 2011-12-08 12:34 | - | |
| Craig Walter E/ | 2011-12-08 12:34 | - | |
| Craig Walter E Lane ..> | 2011-12-08 12:34 | - | |
| Cranor Millicent/ | 2011-12-08 12:35 | - | |
| Craven Martin/ | 2011-12-08 12:35 | - | |
| Crawdaddy/ | 2011-12-08 12:35 | - | |
| Crawford Clifford/ | 2011-12-08 12:36 | - | |
| Crawford Gene Pearson/ | 2011-12-08 12:36 | - | |
| Crawford Paul/ | 2011-12-08 12:36 | - | |
| Crazy Critics/ | 2011-12-08 12:36 | - | |
| CRD Murphy Report 3-..> | 2011-12-08 12:36 | - | |
| Credibility Historic/ | 2011-12-08 12:36 | - | |
| Crehan William/ | 2011-12-08 12:36 | - | |
| Crenshaw Charles A Dr/ | 2011-12-08 12:37 | - | |
| Crime Details/ | 2011-12-08 12:37 | - | |
| Crime FBI Internal A..> | 2011-12-08 12:38 | - | |
| Crime Records Division/ | 2011-12-08 12:38 | - | |
| Crime Research/ | 2011-12-08 12:38 | - | |
| Crime Scene/ | 2011-12-08 12:38 | - | |
| Crime Scene Photos F..> | 2011-12-08 12:38 | - | |
| Crisman Fred Lee/ | 2011-12-08 12:38 | - | |
| Croft Robert Earl/ | 2011-12-08 12:38 | - | |
| Crosby Ned/ | 2011-12-08 12:39 | - | |
| Cross Carolyn/ | 2011-12-08 12:39 | - | |
| Crossfire/ | 2011-12-08 12:39 | - | |
| Crouch Mark/ | 2011-12-08 12:39 | - | |
| Crouch Mark Confiden..> | 2011-12-08 12:39 | - | |
| Crusade for Free Cuba/ | 2011-12-08 12:39 | - | |
| Cruz Miguel Mariano/ | 2011-12-08 12:39 | - | |
| Cuba 06-62/ | 2011-12-08 12:39 | - | |
| Cuba 10-15/ | 2011-12-08 12:39 | - | |
| Cuba 10-20/ | 2011-12-08 12:39 | - | |
| Cuba 10-23/ | 2011-12-08 12:39 | - | |
| Cuba 10-24/ | 2011-12-08 12:39 | - | |
| Cuba 10-25/ | 2011-12-08 12:39 | - | |
| Cuba 10-26/ | 2011-12-08 12:40 | - | |
| Cuba Approach To/ | 2011-12-08 12:40 | - | |
| Cuba Bay of Pigs/ | 2011-12-08 12:40 | - | |
| Cuba Chronology/ | 2011-12-08 12:41 | - | |
| Cuba Clips 4-63/ | 2011-12-08 12:41 | - | |
| Cuba Cooperation in ..> | 2011-12-08 12:41 | - | |
| Cuba Correspondence ..> | 2011-12-08 12:41 | - | |
| Cuba Haiti Invasion of/ | 2011-12-08 12:41 | - | |
| Cuba Hijacking Plane..> | 2011-12-08 12:41 | - | |
| Cuba JFK-Khrushchev ..> | 2011-12-08 12:41 | - | |
| Cuba Miscellaneous/ | 2011-12-08 12:42 | - | |
| Cuba Missiles of Oct..> | 2011-12-08 12:42 | - | |
| Cuba Notes/ | 2011-12-08 12:42 | - | |
| Cuba on the Brink Bl..> | 2011-12-08 12:42 | - | |
| Cuba Post-Settlement/ | 2011-12-08 12:42 | - | |
| Cuba Project The/ | 2011-12-08 12:42 | - | |
| Cuba Raids On/ | 2011-12-08 12:43 | - | |
| Cuba Relations 1-77/ | 2011-12-08 12:43 | - | |
| Cuba Washington Post..> | 2011-12-08 12:43 | - | |
| Cuban Boat Seizures/ | 2011-12-08 12:43 | - | |
| Cuban Exiles Pragmat..> | 2011-12-08 12:43 | - | |
| Cuban Freedom Commit..> | 2011-12-08 12:43 | - | |
| Cuban Gaban-Lopez Mi..> | 2011-12-08 12:43 | - | |
| Cuban Nationalist Mo..> | 2011-12-08 12:43 | - | |
| Cuban Organizations ..> | 2011-12-08 12:44 | - | |
| Cuban Power/ | 2011-12-08 12:44 | - | |
| Cuban Reaction to JF..> | 2011-12-08 12:44 | - | |
| Cuban Revolutionary ..> | 2011-12-08 12:44 | - | |
| Cuban Revolutionary ..> | 2011-12-08 12:44 | - | |
| Cuban Secret Governm..> | 2011-12-08 12:44 | - | |
| Cuban Version of Ass..> | 2011-12-08 12:44 | - | |
| Cuban Violence/ | 2011-12-08 12:45 | - | |
| Cuban-Americans For ..> | 2011-12-08 12:45 | - | |
| Cubania Beligerante/ | 2011-12-08 12:45 | - | |
| Cubans/ | 2011-12-08 12:45 | - | |
| Cubans JFK Assassina..> | 2011-12-08 12:45 | - | |
| Cubela Rolando AMLASH/ | 2011-12-08 12:45 | - | |
| Culligan Roland/ | 2011-12-08 12:45 | - | |
| Cummings Raymond/ | 2011-12-08 12:45 | - | |
| Cuneo Ernest/ | 2011-12-08 12:45 | - | |
| Cunniff Albert/ | 2011-12-08 12:45 | - | |
| Cunningham Cortlandt/ | 2011-12-08 12:45 | - | |
| Cunningham Kathy/ | 2011-12-08 12:45 | - | |
| Cunningham Raymond/ | 2011-12-08 12:45 | - | |
| Curbstone/ | 2011-12-08 12:46 | - | |
| Curiel Gonzalez Cris..> | 2011-12-08 12:46 | - | |
| Curran Edward Judge/ | 2011-12-08 12:46 | - | |
| Curran William J/ | 2011-12-08 12:46 | - | |
| Currington John W/ | 2011-12-08 12:46 | - | |
| Curry Jesse/ | 2011-12-08 12:46 | - | |
| Curry Jesse Chief Da..> | 2011-12-08 12:46 | - | |
| Curry Kenneth Confid..> | 2011-12-08 12:47 | - | |
| Curtain Rods/ | 2011-12-08 12:47 | - | |
| Curtis Don Teel Dr/ | 2011-12-08 12:47 | - | |
| Curtis Raymond L OPR..> | 2011-12-08 12:47 | - | |
| Curtis Richard/ | 2011-12-08 12:47 | - | |
| Cusco Jose/ | 2011-12-08 12:47 | - | |
| Cushing Richard Card..> | 2011-12-08 12:47 | - | |
| Custer Jerrol/ | 2011-12-08 12:47 | - | |
| Cutler Robert B/ | 2011-12-08 12:48 | - | |
| Czechoslovakia/ | 2011-12-08 12:48 | - | |
| Conspiracy Theories/ | 2013-01-08 11:10 | - | |
| C Letter/ | 2013-06-10 14:28 | - | |
| Connally John B Jr D..> | 2013-06-10 14:31 | - | |