![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Zapruder 1988/ | 2023-04-14 02:13 | - | |
| Wrone To Weisberg/ | 2023-04-14 02:13 | - | |
| Wrone - JFK Essay/ | 2023-04-14 02:13 | - | |
| Wrone - JFK Course M..> | 2023-04-14 02:13 | - | |
| Wrone - Book Review/ | 2023-04-14 02:13 | - | |
| Witnesses/ | 2023-04-14 02:13 | - | |
| Witness Statement Bo..> | 2023-04-14 02:13 | - | |
| Witness Statement Bo..> | 2023-04-14 02:13 | - | |
| Witness Statement Bo..> | 2023-04-14 02:13 | - | |
| Witness Statement Bo..> | 2023-04-14 02:13 | - | |
| Witness List/ | 2023-04-14 02:13 | - | |
| Weisberg Oswald In N..> | 2023-04-14 02:13 | - | |
| Weisberg Manuscripts/ | 2023-04-14 02:13 | - | |
| Weisberg Letters Key..> | 2023-04-14 02:13 | - | |
| Weisberg Cassettes/ | 2023-04-14 02:13 | - | |
| Weisberg 1978-08/ | 2023-04-14 02:13 | - | |
| Weisberg 1978-07/ | 2023-04-14 02:13 | - | |
| Weisberg 1978-06/ | 2023-04-14 02:13 | - | |
| Weisberg 1978-05/ | 2023-04-14 02:13 | - | |
| Weisberg 1978-03/ | 2023-04-14 02:13 | - | |
| Weisberg 1978-02/ | 2023-04-14 02:13 | - | |
| Weisberg 1978-01/ | 2023-04-14 02:13 | - | |
| Weisberg 1977-12/ | 2023-04-14 02:13 | - | |
| Weisberg 1977-11/ | 2023-04-14 02:13 | - | |
| Weisberg 1977-10/ | 2023-04-14 02:13 | - | |
| Weisberg 1977-09/ | 2023-04-14 02:13 | - | |
| Weisberg 1977-08/ | 2023-04-14 02:13 | - | |
| Weisberg 1977-07/ | 2023-04-14 02:13 | - | |
| Weisberg 1977-06/ | 2023-04-14 02:13 | - | |
| Weisberg 1977-05/ | 2023-04-14 02:13 | - | |
| Weisberg 1977-04/ | 2023-04-14 02:13 | - | |
| Weisberg 1977-03/ | 2023-04-14 02:13 | - | |
| Weisberg - Books/ | 2023-04-14 02:13 | - | |
| Weisberg - Biography/ | 2023-04-14 02:13 | - | |
| Warren Report - In P..> | 2023-04-14 02:13 | - | |
| Warren Commission St..> | 2023-04-14 02:13 | - | |
| Warren Commission Ex..> | 2023-04-14 02:13 | - | |
| Warren Commission Ex..> | 2023-04-14 02:13 | - | |
| Warren Commission Ex..> | 2023-04-14 02:13 | - | |
| Warren Commission Ex..> | 2023-04-14 02:13 | - | |
| Warren Commission/ | 2023-04-14 02:13 | - | |
| Walker/ | 2023-04-14 02:13 | - | |
| Wade Henry/ | 2023-04-14 02:13 | - | |
| Valentine Paul/ | 2023-04-14 02:13 | - | |
| U-2/ | 2023-04-14 02:13 | - | |
| Tramps/ | 2023-04-14 02:13 | - | |
| Trafficante/ | 2023-04-14 02:13 | - | |
| Tools Of History Foo..> | 2023-04-14 02:13 | - | |
| Tippit/ | 2023-04-14 02:13 | - | |
| Tiger/ | 2023-04-14 02:13 | - | |
| Threats/ | 2023-04-14 02:13 | - | |
| Threats-2/ | 2023-04-14 02:13 | - | |
| Thomas Jack/ | 2023-04-14 02:13 | - | |
| Theories On K/ | 2023-04-14 02:13 | - | |
| Texas Court Of Inquiry/ | 2023-04-14 02:13 | - | |
| TCI/ | 2023-04-14 02:13 | - | |
| Spectroscopy/ | 2023-04-14 02:13 | - | |
| Sketch King Assass/ | 2023-04-14 02:13 | - | |
| Sirhan/ | 2023-04-14 02:13 | - | |
| Shots Outside Of Car/ | 2023-04-14 02:13 | - | |
| Shots Other/ | 2023-04-14 02:13 | - | |
| Shots Direction/ | 2023-04-14 02:13 | - | |
| Shots Bullets/ | 2023-04-14 02:13 | - | |
| Shots/ | 2023-04-14 02:13 | - | |
| Shot Front/ | 2023-04-14 02:13 | - | |
| Shaw Trial Transcript/ | 2023-04-14 02:13 | - | |
| Shaw J Gary/ | 2023-04-14 02:13 | - | |
| Secret Service Files..> | 2023-04-14 02:13 | - | |
| Schweiker Report Emb..> | 2023-04-14 02:13 | - | |
| Schweiker Report 1-7..> | 2023-04-14 02:13 | - | |
| Schweiker/ | 2023-04-14 02:13 | - | |
| Schur Bertam H US AEC/ | 2023-04-14 02:13 | - | |
| Schorr Daniel/ | 2023-04-14 02:13 | - | |
| Schiff Book FDR Affair/ | 2023-04-14 02:13 | - | |
| SIOP/ | 2023-04-14 02:13 | - | |
| Russell R/ | 2023-04-14 02:13 | - | |
| Russell Man Who Knew..> | 2023-04-14 02:13 | - | |
| Ruby Psychiatric Rep..> | 2023-04-14 02:13 | - | |
| Ruby Jack - Medical/ | 2023-04-14 02:13 | - | |
| Ruby/ | 2023-04-14 02:13 | - | |
| Rothermel Paul/ | 2023-04-14 02:13 | - | |
| Rosselli John CIA-Ma..> | 2023-04-14 02:13 | - | |
| Rosenberg Lawyers An..> | 2023-04-14 02:13 | - | |
| Roselli John CIA-Maf..> | 2023-04-14 02:13 | - | |
| Roffman Howard Revie..> | 2023-04-14 02:13 | - | |
| Right-Wing/ | 2023-04-14 02:13 | - | |
| Rifle And TSBD/ | 2023-04-14 02:13 | - | |
| Richards Norm/ | 2023-04-14 02:13 | - | |
| Rice JFK Bibliography/ | 2023-04-14 02:13 | - | |
| Revill Jack/ | 2023-04-14 02:13 | - | |
| Reviews Of Books On ..> | 2023-04-14 02:13 | - | |
| Reston James Jr Conn..> | 2023-04-14 02:13 | - | |
| Research Grant/ | 2023-04-14 02:13 | - | |
| Reporters Committee ..> | 2023-04-14 02:13 | - | |
| Reeves Richards Ques..> | 2023-04-14 02:13 | - | |
| Redlich Norman/ | 2023-04-14 02:13 | - | |
| Rays Trial October 1..> | 2023-04-14 02:13 | - | |
| Ravet Jim Milwaukee ..> | 2023-04-14 02:13 | - | |
| Rather Dan/ | 2023-04-14 02:13 | - | |
| Rand Study/ | 2023-04-14 02:13 | - | |
| RFK Copy Harper Lett..> | 2023-04-14 02:13 | - | |
| Prouty L Fletcher/ | 2023-04-14 02:13 | - | |
| Prouty Fletch Greate..> | 2023-04-14 02:13 | - | |
| Press Clippings Symp..> | 2023-04-14 02:13 | - | |
| Press Clippings FBI-..> | 2023-04-14 02:13 | - | |
| Press And CIA/ | 2023-04-14 02:13 | - | |
| Press/ | 2023-04-14 02:13 | - | |
| Post Mortem/ | 2023-04-14 02:13 | - | |
| Posner-Hartogs/ | 2023-04-14 02:13 | - | |
| Posner-Autopsy/ | 2023-04-14 02:13 | - | |
| Police Depositions/ | 2023-04-14 02:13 | - | |
| Photos Integrity/ | 2023-04-14 02:13 | - | |
| Photographs/ | 2023-04-14 02:13 | - | |
| Periodicals JFK/ | 2023-04-14 02:13 | - | |
| Peck Sidney Sociology/ | 2023-04-14 02:13 | - | |
| Payne Les Cop Was Re..> | 2023-04-14 02:13 | - | |
| Paraffin Tests/ | 2023-04-14 02:13 | - | |
| Oswald TSBD/ | 2023-04-14 02:13 | - | |
| Oswald Rifle Picture/ | 2023-04-14 02:13 | - | |
| Oswald Mexico/ | 2023-04-14 02:13 | - | |
| Oswald Letter To Hunt/ | 2023-04-14 02:13 | - | |
| Oswald Lee H And CIA/ | 2023-04-14 02:13 | - | |
| Oswald In Depository/ | 2023-04-14 02:13 | - | |
| Oswald First Floor/ | 2023-04-14 02:13 | - | |
| Oswald Exclusion/ | 2023-04-14 02:13 | - | |
| Oswald Diary/ | 2023-04-14 02:13 | - | |
| Oswald Chronology/ | 2023-04-14 02:13 | - | |
| Oswald And Intellige..> | 2023-04-14 02:13 | - | |
| Oswald/ | 2023-04-14 02:13 | - | |
| Oswald - Marina/ | 2023-04-14 02:13 | - | |
| Oswald - False/ | 2023-04-14 02:13 | - | |
| Oswald - Diary Ford/ | 2023-04-14 02:13 | - | |
| Oswald - Clothing/ | 2023-04-14 02:13 | - | |
| Olney W/ | 2023-04-14 02:13 | - | |
| Nov 22 Press Confere..> | 2023-04-14 02:13 | - | |
| Notes JFK/ | 2023-04-14 02:13 | - | |
| Nonfatal Wounds/ | 2023-04-14 02:13 | - | |
| Nixon Resignation/ | 2023-04-14 02:13 | - | |
| Nixon Letter To DRV ..> | 2023-04-14 02:13 | - | |
| Nixon Granting Of A ..> | 2023-04-14 02:13 | - | |
| Nixon General/ | 2023-04-14 02:13 | - | |
| Nichols John Woundin..> | 2023-04-14 02:13 | - | |
| Nichols John Dr 1974/ | 2023-04-14 02:13 | - | |
| New Republic/ | 2023-04-14 02:13 | - | |
| New Orleans 11-11-77/ | 2023-04-14 02:13 | - | |
| Never Again-Afterword/ | 2023-04-14 02:13 | - | |
| Neutron Activation A..> | 2023-04-14 02:13 | - | |
| Neichter/ | 2023-04-14 02:13 | - | |
| Navy/ | 2023-04-14 02:13 | - | |
| National Archives-Za..> | 2023-04-14 02:13 | - | |
| NSAM 263 Viet Withdr..> | 2023-04-14 02:13 | - | |
| NBC King Series/ | 2023-04-14 02:13 | - | |
| Murkin By Melanson/ | 2023-04-14 02:13 | - | |
| Moyers William/ | 2023-04-14 02:13 | - | |
| Moorman M-5 Spec Dis..> | 2023-04-14 02:13 | - | |
| Miner Ruth/ | 2023-04-14 02:13 | - | |
| Miami Herald MLK Ass..> | 2023-04-14 02:13 | - | |
| Melanson/ | 2023-04-14 02:13 | - | |
| Medical Panel 4-11-78/ | 2023-04-14 02:13 | - | |
| Medical Examiner/ | 2023-04-14 02:13 | - | |
| Media/ | 2023-04-14 02:13 | - | |
| Meagher Sylvia/ | 2023-04-14 02:13 | - | |
| Meagher Eulogy/ | 2023-04-14 02:13 | - | |
| McMillan Priscilla/ | 2023-04-14 02:13 | - | |
| McMillan George/ | 2023-04-14 02:13 | - | |
| McDermid Harold E/ | 2023-04-14 02:13 | - | |
| McDade Thomas M/ | 2023-04-14 02:13 | - | |
| McCloy/ | 2023-04-14 02:13 | - | |
| Martin David C/ | 2023-04-14 02:13 | - | |
| Map/ | 2023-04-14 02:13 | - | |
| Mannlicher-Carcano H..> | 2023-04-14 02:13 | - | |
| Malone W/ | 2023-04-14 02:13 | - | |
| Mafia/ | 2023-04-14 02:13 | - | |
| MLK We Still Beleive..> | 2023-04-14 02:13 | - | |
| MLK Chrono/ | 2023-04-14 02:13 | - | |
| Lovelady-CBS/ | 2023-04-14 02:13 | - | |
| Lorenz Marita Operat..> | 2023-04-14 02:13 | - | |
| Lopez Report/ | 2023-04-14 02:13 | - | |
| Livingstone Book/ | 2023-04-14 02:13 | - | |
| Livingston/ | 2023-04-14 02:13 | - | |
| Lifton/ | 2023-04-14 02:13 | - | |
| Lewis Anthony/ | 2023-04-14 02:13 | - | |
| Lesar Letter From Wr..> | 2023-04-14 02:13 | - | |
| Lesar Jim Prior To 75/ | 2023-04-14 02:13 | - | |
| Lesar Jim FOIA Reque..> | 2023-04-14 02:13 | - | |
| Lesar Jim 11-22-73/ | 2023-04-14 02:13 | - | |
| Lesar Jim/ | 2023-04-14 02:13 | - | |
| Lecture Material -- ..> | 2023-04-14 02:13 | - | |
| Lecture Material -- ..> | 2023-04-14 02:13 | - | |
| Lane Plausible Denial/ | 2023-04-14 02:13 | - | |
| Lane Letter From Wrone/ | 2023-04-14 02:13 | - | |
| LaFontaine Book Docu..> | 2023-04-14 02:13 | - | |
| LaFontaine/ | 2023-04-14 02:13 | - | |
| LBJ Telephone Logs/ | 2023-04-14 02:13 | - | |
| LBJ Control/ | 2023-04-14 02:13 | - | |
| Kurtz Mike/ | 2023-04-14 02:13 | - | |
| Kubicek Earl C/ | 2023-04-14 02:13 | - | |
| Kissinger/ | 2023-04-14 02:13 | - | |
| King Records/ | 2023-04-14 02:13 | - | |
| King M L Threats Apr..> | 2023-04-14 02:13 | - | |
| King A Filmed Record/ | 2023-04-14 02:13 | - | |
| King/ | 2023-04-14 02:13 | - | |
| King - Chastain Killer/ | 2023-04-14 02:13 | - | |
| Kevin Art/ | 2023-04-14 02:13 | - | |
| Kennedy John F Corre..> | 2023-04-14 02:13 | - | |
| Kennedy John F Books..> | 2023-04-14 02:13 | - | |
| Kennedy Family Blame..> | 2023-04-14 02:13 | - | |
| Kennedy As President/ | 2023-04-14 02:13 | - | |
| Katzenbach Memo/ | 2023-04-14 02:13 | - | |
| Kantor Seth The Secr..> | 2023-04-14 02:13 | - | |
| Kantor Seth/ | 2023-04-14 02:13 | - | |
| K Critics/ | 2023-04-14 02:13 | - | |
| Jones Penn Jr/ | 2023-04-14 02:13 | - | |
| Johnson Lyndon B Lib..> | 2023-04-14 02:13 | - | |
| Joesten J Widow Mae/ | 2023-04-14 02:13 | - | |
| Jenkins John/ | 2023-04-14 02:13 | - | |
| Jaworski Leon/ | 2023-04-14 02:13 | - | |
| Jaco C D Jerry Ray/ | 2023-04-14 02:13 | - | |
| JFK Wounds/ | 2023-04-14 02:13 | - | |
| JFK Witnesses/ | 2023-04-14 02:13 | - | |
| JFK Presidential Car/ | 2023-04-14 02:13 | - | |
| JFK Foreign Policy/ | 2023-04-14 02:13 | - | |
| JFK Course Notes-Out..> | 2023-04-14 02:13 | - | |
| JFK Clothing/ | 2023-04-14 02:13 | - | |
| JFK Back/ | 2023-04-14 02:13 | - | |
| JFK Assassination Bi..> | 2023-04-14 02:13 | - | |
| Irwin Harry/ | 2023-04-14 02:13 | - | |
| Investigation Refusal/ | 2023-04-14 02:13 | - | |
| Investigation - FBI/ | 2023-04-14 02:13 | - | |
| Intelligence/ | 2023-04-14 02:13 | - | |
| Hudkins/ | 2023-04-14 02:13 | - | |
| House Select Committ..> | 2023-04-14 02:13 | - | |
| House Select Committ..> | 2023-04-14 02:13 | - | |
| House Inquiry News A..> | 2023-04-14 02:13 | - | |
| Hosty/ | 2023-04-14 02:13 | - | |
| Horrock Nicholas M O..> | 2023-04-14 02:13 | - | |
| Hopkins G E/ | 2023-04-14 02:13 | - | |
| Hoovers Crisis/ | 2023-04-14 02:13 | - | |
| Hoover J Edgar Mater..> | 2023-04-14 02:13 | - | |
| Hoover J Edgar, Docu..> | 2023-04-14 02:13 | - | |
| Hoover Herbert Criti..> | 2023-04-14 02:13 | - | |
| Hood/ | 2023-04-14 02:13 | - | |
| Honorable Men/ | 2023-04-14 02:13 | - | |
| Historians And JFK/ | 2023-04-14 02:13 | - | |
| Hiss/ | 2023-04-14 02:13 | - | |
| Hersh Sampson Option/ | 2023-04-14 02:13 | - | |
| Haywood William Bibl..> | 2023-04-14 02:13 | - | |
| Halleck Decision - G..> | 2023-04-14 02:13 | - | |
| Hall Kermit/ | 2023-04-14 02:13 | - | |
| HSCA Book Review Pro..> | 2023-04-14 02:13 | - | |
| Greenwood JFK/ | 2023-04-14 02:13 | - | |
| Gratuitous Mystery/ | 2023-04-14 02:13 | - | |
| Goldberg Alfred/ | 2023-04-14 02:13 | - | |
| Ginocchio Gerry/ | 2023-04-14 02:13 | - | |
| Gertz Elmer Register..> | 2023-04-14 02:13 | - | |
| General/ | 2023-04-14 02:13 | - | |
| Garrison Trial/ | 2023-04-14 02:13 | - | |
| Gallen/ | 2023-04-14 02:13 | - | |
| Ford/ | 2023-04-14 02:13 | - | |
| Fingerprints/ | 2023-04-14 02:13 | - | |
| Fensterwald Bernard F/ | 2023-04-14 02:13 | - | |
| Farewell America Boo..> | 2023-04-14 02:13 | - | |
| Farewell America/ | 2023-04-14 02:13 | - | |
| Fairleigh DUP/ | 2023-04-14 02:13 | - | |
| FOIA List Of Cases/ | 2023-04-14 02:13 | - | |
| FBI Tickler Outline/ | 2023-04-14 02:13 | - | |
| FBI Structure/ | 2023-04-14 02:13 | - | |
| FBI Spartansburg-3 1..> | 2023-04-14 02:13 | - | |
| FBI Manchester/ | 2023-04-14 02:13 | - | |
| FBI Kennedy Relation..> | 2023-04-14 02:13 | - | |
| FBI Investigations/ | 2023-04-14 02:13 | - | |
| FBI Initial Report T..> | 2023-04-14 02:13 | - | |
| FBI Critics/ | 2023-04-14 02:13 | - | |
| FBI And Famous Peopl..> | 2023-04-14 02:13 | - | |
| FBI Agents Censure/ | 2023-04-14 02:13 | - | |
| Evans Bill 1975/ | 2023-04-14 02:13 | - | |
| Edwards Sheffield CI..> | 2023-04-14 02:13 | - | |
| Eddowes Michael/ | 2023-04-14 02:13 | - | |
| Download/ | 2023-04-14 02:13 | - | |
| Donahue/ | 2023-04-14 02:13 | - | |
| Documentary Films ON..> | 2023-04-14 02:13 | - | |
| Document Releases 12..> | 2023-04-14 02:13 | - | |
| Dickenson J/ | 2023-04-14 02:13 | - | |
| Denny Earl R 5-76/ | 2023-04-14 02:13 | - | |
| Demohrenschildt Geor..> | 2023-04-14 02:13 | - | |
| Demaris Ovid/ | 2023-04-14 02:13 | - | |
| Dealey Plaza Map/ | 2023-04-14 02:13 | - | |
| Davison Alexis/ | 2023-04-14 02:13 | - | |
| Dallas Field Office ..> | 2023-04-14 02:13 | - | |
| Cutler Robert Flyers..> | 2023-04-14 02:13 | - | |
| Cutler Robert/ | 2023-04-14 02:13 | - | |
| Curse Of Theory/ | 2023-04-14 02:13 | - | |
| Curry/ | 2023-04-14 02:13 | - | |
| Critics Irresponsibl..> | 2023-04-14 02:13 | - | |
| Critics History Of/ | 2023-04-14 02:13 | - | |
| Critics/ | 2023-04-14 02:13 | - | |
| Crenshaw-Wecht Folder/ | 2023-04-14 02:13 | - | |
| Correspondence To HW/ | 2023-04-14 02:13 | - | |
| Correspondence 1988/ | 2023-04-14 02:13 | - | |
| Correspondence/ | 2023-04-14 02:13 | - | |
| Cooper/ | 2023-04-14 02:13 | - | |
| Cook Fred J/ | 2023-04-14 02:13 | - | |
| Control-Writers/ | 2023-04-14 02:13 | - | |
| Control-Within FBI/ | 2023-04-14 02:13 | - | |
| Control-WC/ | 2023-04-14 02:13 | - | |
| Control-Secret Service/ | 2023-04-14 02:13 | - | |
| Control-Press Leaks/ | 2023-04-14 02:13 | - | |
| Control-Misrepresent..> | 2023-04-14 02:13 | - | |
| Control-Misinformation/ | 2023-04-14 02:13 | - | |
| Control-Memory Hole/ | 2023-04-14 02:13 | - | |
| Control-Hoover/ | 2023-04-14 02:13 | - | |
| Control-General/ | 2023-04-14 02:13 | - | |
| Control-Garrison/ | 2023-04-14 02:13 | - | |
| Control-FBI/ | 2023-04-14 02:13 | - | |
| Control-Congress/ | 2023-04-14 02:13 | - | |
| Control-Categories Of/ | 2023-04-14 02:13 | - | |
| Control-Book/ | 2023-04-14 02:13 | - | |
| Connally Fragments/ | 2023-04-14 02:13 | - | |
| Communism Misc Books..> | 2023-04-14 02:13 | - | |
| Cointelpro FBI Misc ..> | 2023-04-14 02:13 | - | |
| Clandestine America/ | 2023-04-14 02:13 | - | |
| Case Open Manuscript/ | 2023-04-14 02:13 | - | |
| Capital Times 1976 A..> | 2023-04-14 02:13 | - | |
| CTIA Committee Of Fe..> | 2023-04-14 02:13 | - | |
| CIA Mind Control/ | 2023-04-14 02:13 | - | |
| CIA Lies In Vietnam/ | 2023-04-14 02:13 | - | |
| CIA History/ | 2023-04-14 02:13 | - | |
| CIA Domestic/ | 2023-04-14 02:13 | - | |
| CIA Documents Part 2/ | 2023-04-14 02:13 | - | |
| CIA Documents/ | 2023-04-14 02:13 | - | |
| CIA Criticism Of/ | 2023-04-14 02:13 | - | |
| CIA Clandestine Acti..> | 2023-04-14 02:13 | - | |
| CIA And FOIA/ | 2023-04-14 02:13 | - | |
| CIA/ | 2023-04-14 02:13 | - | |
| CE 399/ | 2023-04-14 02:13 | - | |
| CD-1/ | 2023-04-14 02:13 | - | |
| CBS Time Of Assassin..> | 2023-04-14 02:13 | - | |
| CBS Special 11-75 We..> | 2023-04-14 02:13 | - | |
| CBS Ltr To Stanton 6..> | 2023-04-14 02:13 | - | |
| CBS/ | 2023-04-14 02:13 | - | |
| CBS-Ruby And Oswald/ | 2023-04-14 02:13 | - | |
| Bulletry/ | 2023-04-14 02:13 | - | |
| Brazil 1964 Navy Thr..> | 2023-04-14 02:13 | - | |
| Books/ | 2023-04-14 02:13 | - | |
| Book Reviews By Wrone/ | 2023-04-14 02:13 | - | |
| Book Review In NYT O..> | 2023-04-14 02:13 | - | |
| Book Oswald Notes Re/ | 2023-04-14 02:13 | - | |
| Book FOIA And Politi..> | 2023-04-14 02:13 | - | |
| Book Dealers/ | 2023-04-14 02:13 | - | |
| Black Arts Misc Info..> | 2023-04-14 02:13 | - | |
| Beschloss/ | 2023-04-14 02:13 | - | |
| Bell Griffin/ | 2023-04-14 02:13 | - | |
| Belin David - Wesibe..> | 2023-04-14 02:13 | - | |
| Belin Critique/ | 2023-04-14 02:13 | - | |
| Baskerville Donald A/ | 2023-04-14 02:13 | - | |
| Ballistics/ | 2023-04-14 02:13 | - | |
| Baird Clifton MLK Plot/ | 2023-04-14 02:13 | - | |
| Bailey Tom/ | 2023-04-14 02:13 | - | |
| Bag/ | 2023-04-14 02:13 | - | |
| Autopsy Witnesses/ | 2023-04-14 02:13 | - | |
| Autopsy Records Of/ | 2023-04-14 02:13 | - | |
| Autopsy Finck/ | 2023-04-14 02:13 | - | |
| Autopsy Doc Chain/ | 2023-04-14 02:13 | - | |
| Autopsy/ | 2023-04-14 02:13 | - | |
| Assassination Story-..> | 2023-04-14 02:13 | - | |
| Assassination Archives/ | 2023-04-14 02:13 | - | |
| Articles For History..> | 2023-04-14 02:13 | - | |
| Archives Communicati..> | 2023-04-14 02:13 | - | |
| Archives-JFK Draft C..> | 2023-04-14 02:13 | - | |
| Anson R S/ | 2023-04-14 02:13 | - | |
| Americana Religious ..> | 2023-04-14 02:13 | - | |
| Americana Distortion..> | 2023-04-14 02:13 | - | |
| Alvarez Luis/ | 2023-04-14 02:13 | - | |
| Alvarado/ | 2023-04-14 02:13 | - | |
| Agnew Exposition Of ..> | 2023-04-14 02:13 | - | |
| Agent Oswald/ | 2023-04-14 02:13 | - | |
| Acoustic Chain/ | 2023-04-14 02:13 | - | |
| Abzug Committee/ | 2023-04-14 02:13 | - | |
| Abzug/ | 2023-04-14 02:13 | - | |
| AMEU Inc/ | 2023-04-14 02:13 | - | |
| AMEU 05/ | 2023-04-14 02:13 | - | |
| AF-1 Radio Log On Re..> | 2023-04-14 02:13 | - | |
| ABC Evidentiary Misr..> | 2023-04-14 02:13 | - | |
| ABC-TV Trial Of Lee ..> | 2023-04-14 02:13 | - | |
| AARC Quarterly/ | 2023-04-14 02:13 | - | |